C22H24FN5O2Si — CID 140838249
6-fluoro-N-[8-(2-trimethylsilylethoxymethyl)-4,8,10-triazatricyclo[7.4.0.02,7]trideca-1(9),2(7),3,5,10,12-hexaen-11-yl]pyridine-3-carboxamide (PubChem CID 140838249) has the molecular formula C22H24FN5O2Si and a molecular weight of 437.55 g/mol. Its IUPAC name is 6-fluoro-N-[8-(2-trimethylsilylethoxymethyl)-4,8,10-triazatricyclo[7.4.0.02,7]trideca-1(9),2(7),3,5,10,12-hexaen-11-yl]pyridine-3-carboxamide.
| Compound Name | 6-fluoro-N-[8-(2-trimethylsilylethoxymethyl)-4,8,10-triazatricyclo[7.4.0.02,7]trideca-1(9),2(7),3,5,10,12-hexaen-11-yl]pyridine-3-carboxamide |
|---|---|
| PubChem CID | 140838249 |
| Molecular Formula | C22H24FN5O2Si |
| Molecular Weight | 437.55 g/mol |
| Exact Mass | 437.17 |
| IUPAC Name | 6-fluoro-N-[8-(2-trimethylsilylethoxymethyl)-4,8,10-triazatricyclo[7.4.0.02,7]trideca-1(9),2(7),3,5,10,12-hexaen-11-yl]pyridine-3-carboxamide |
| SMILES | C[Si](C)(C)CCOCn1c2ccncc2c2ccc(NC(=O)c3ccc(F)nc3)nc21 |
| InChI | InChI=1S/C22H24FN5O2Si/c1-31(2,3)11-10-30-14-28-18-8-9-24-13-17(18)16-5-7-20(26-21(16)28)27-22(29)15-4-6-19(23)25-12-15/h4-9,12-13H,10-11,14H2,1-3H3,(H,26,27,29) |
| InChIKey | IYXIRZPWMNSEAN-UHFFFAOYSA-N |
| XLogP | 4.68 |
| TPSA | 81.93 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 437.55 |
| LogP ≤ 5 | 4.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|