C24H19BF10N4O2 — CID 140838332
2,4-bis(1,1,2,2,2-pentafluoroethyl)-6-[6-[4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]-3-pyridinyl]-1,3,5-triazine (PubChem CID 140838332) has the molecular formula C24H19BF10N4O2 and a molecular weight of 596.23 g/mol. Its IUPAC name is 2,4-bis(1,1,2,2,2-pentafluoroethyl)-6-[6-[4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]-3-pyridinyl]-1,3,5-triazine.
| Compound Name | 2,4-bis(1,1,2,2,2-pentafluoroethyl)-6-[6-[4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]-3-pyridinyl]-1,3,5-triazine |
|---|---|
| PubChem CID | 140838332 |
| Molecular Formula | C24H19BF10N4O2 |
| Molecular Weight | 596.23 g/mol |
| Exact Mass | 596.14 |
| IUPAC Name | 2,4-bis(1,1,2,2,2-pentafluoroethyl)-6-[6-[4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]-3-pyridinyl]-1,3,5-triazine |
| SMILES | CC1(C)OB(c2ccc(-c3ccc(-c4nc(C(F)(F)C(F)(F)F)nc(C(F)(F)C(F)(F)F)n4)cn3)cc2)OC1(C)C |
| InChI | InChI=1S/C24H19BF10N4O2/c1-19(2)20(3,4)41-25(40-19)14-8-5-12(6-9-14)15-10-7-13(11-36-15)16-37-17(21(26,27)23(30,31)32)39-18(38-16)22(28,29)24(33,34)35/h5-11H,1-4H3 |
| InChIKey | KFFLQZFCNOXIHS-UHFFFAOYSA-N |
| XLogP | 6.21 |
| TPSA | 70.02 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 596.23 |
| LogP ≤ 5 | 6.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|