C32H35BN4O2 — CID 140838456
2-cyclohexyl-4-phenyl-6-[6-[4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]-3-pyridinyl]-1,3,5-triazine (PubChem CID 140838456) has the molecular formula C32H35BN4O2 and a molecular weight of 518.47 g/mol. Its IUPAC name is 2-cyclohexyl-4-phenyl-6-[6-[4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]-3-pyridinyl]-1,3,5-triazine.
| Compound Name | 2-cyclohexyl-4-phenyl-6-[6-[4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]-3-pyridinyl]-1,3,5-triazine |
|---|---|
| PubChem CID | 140838456 |
| Molecular Formula | C32H35BN4O2 |
| Molecular Weight | 518.47 g/mol |
| Exact Mass | 518.29 |
| IUPAC Name | 2-cyclohexyl-4-phenyl-6-[6-[4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]-3-pyridinyl]-1,3,5-triazine |
| SMILES | CC1(C)OB(c2ccc(-c3ccc(-c4nc(-c5ccccc5)nc(C5CCCCC5)n4)cn3)cc2)OC1(C)C |
| InChI | InChI=1S/C32H35BN4O2/c1-31(2)32(3,4)39-33(38-31)26-18-15-22(16-19-26)27-20-17-25(21-34-27)30-36-28(23-11-7-5-8-12-23)35-29(37-30)24-13-9-6-10-14-24/h5,7-8,11-12,15-21,24H,6,9-10,13-14H2,1-4H3 |
| InChIKey | PDVZSQPRGFYNTH-UHFFFAOYSA-N |
| XLogP | 6.61 |
| TPSA | 70.02 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 518.47 |
| LogP ≤ 5 | 6.61 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|