C24H25BFNO2 — CID 140838545
5-(3-fluorophenyl)-4-methyl-2-[4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]pyridine (PubChem CID 140838545) has the molecular formula C24H25BFNO2 and a molecular weight of 389.28 g/mol. Its IUPAC name is 5-(3-fluorophenyl)-4-methyl-2-[4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]pyridine.
| Compound Name | 5-(3-fluorophenyl)-4-methyl-2-[4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]pyridine |
|---|---|
| PubChem CID | 140838545 |
| Molecular Formula | C24H25BFNO2 |
| Molecular Weight | 389.28 g/mol |
| Exact Mass | 389.20 |
| IUPAC Name | 5-(3-fluorophenyl)-4-methyl-2-[4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]pyridine |
| SMILES | Cc1cc(-c2ccc(B3OC(C)(C)C(C)(C)O3)cc2)ncc1-c1cccc(F)c1 |
| InChI | InChI=1S/C24H25BFNO2/c1-16-13-22(27-15-21(16)18-7-6-8-20(26)14-18)17-9-11-19(12-10-17)25-28-23(2,3)24(4,5)29-25/h6-15H,1-5H3 |
| InChIKey | IGTGSMOCAQZQFY-UHFFFAOYSA-N |
| XLogP | 5.16 |
| TPSA | 31.35 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 389.28 |
| LogP ≤ 5 | 5.16 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|