C22H27BN2O3 — CID 140838666
4-tert-butyl-9-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyrimido[2,1-a]isoquinolin-2-one (PubChem CID 140838666) has the molecular formula C22H27BN2O3 and a molecular weight of 378.28 g/mol. Its IUPAC name is 4-tert-butyl-9-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyrimido[2,1-a]isoquinolin-2-one.
| Compound Name | 4-tert-butyl-9-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyrimido[2,1-a]isoquinolin-2-one |
|---|---|
| PubChem CID | 140838666 |
| Molecular Formula | C22H27BN2O3 |
| Molecular Weight | 378.28 g/mol |
| Exact Mass | 378.21 |
| IUPAC Name | 4-tert-butyl-9-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyrimido[2,1-a]isoquinolin-2-one |
| SMILES | CC(C)(C)c1cc(=O)nc2c3ccc(B4OC(C)(C)C(C)(C)O4)cc3ccn12 |
| InChI | InChI=1S/C22H27BN2O3/c1-20(2,3)17-13-18(26)24-19-16-9-8-15(12-14(16)10-11-25(17)19)23-27-21(4,5)22(6,7)28-23/h8-13H,1-7H3 |
| InChIKey | VUDCFRATGNWBPA-UHFFFAOYSA-N |
| XLogP | 3.44 |
| TPSA | 52.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.28 |
| LogP ≤ 5 | 3.44 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|