C25H31BN2O3 — CID 140838735
3,3,5,5-tetramethyl-16-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-1,14-diazatetracyclo[11.4.0.02,6.07,12]heptadeca-2(6),7,9,11,13,16-hexaen-15-one (PubChem CID 140838735) has the molecular formula C25H31BN2O3 and a molecular weight of 418.35 g/mol. Its IUPAC name is 3,3,5,5-tetramethyl-16-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-1,14-diazatetracyclo[11.4.0.02,6.07,12]heptadeca-2(6),7,9,11,13,16-hexaen-15-one.
| Compound Name | 3,3,5,5-tetramethyl-16-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-1,14-diazatetracyclo[11.4.0.02,6.07,12]heptadeca-2(6),7,9,11,13,16-hexaen-15-one |
|---|---|
| PubChem CID | 140838735 |
| Molecular Formula | C25H31BN2O3 |
| Molecular Weight | 418.35 g/mol |
| Exact Mass | 418.24 |
| IUPAC Name | 3,3,5,5-tetramethyl-16-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-1,14-diazatetracyclo[11.4.0.02,6.07,12]heptadeca-2(6),7,9,11,13,16-hexaen-15-one |
| SMILES | CC1(C)CC(C)(C)c2c1c1ccccc1c1nc(=O)c(B3OC(C)(C)C(C)(C)O3)cn21 |
| InChI | InChI=1S/C25H31BN2O3/c1-22(2)14-23(3,4)19-18(22)15-11-9-10-12-16(15)20-27-21(29)17(13-28(19)20)26-30-24(5,6)25(7,8)31-26/h9-13H,14H2,1-8H3 |
| InChIKey | DOTXOJHINVWCGY-UHFFFAOYSA-N |
| XLogP | 4.11 |
| TPSA | 52.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 418.35 |
| LogP ≤ 5 | 4.11 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|