About CID 140838861
CID 140838861 (PubChem CID 140838861) has the molecular formula C63H39IrN6O3
and a molecular weight of 1120.26 g/mol.
Molecular Properties
| Compound Name | CID 140838861 |
| PubChem CID | 140838861 |
| Molecular Formula | C63H39IrN6O3 |
| Molecular Weight | 1120.26 g/mol |
| Exact Mass | 1120.27 |
| IUPAC Name | — |
| SMILES | [Ir+3].[c-]1cc2ncc1-c1ccc(cn1)-c1ccccc1-c1cc3cc(c1)-c1ccccc1-c1ccc(nc1)-c1[c-]cc(nc1)OCc1cc(cc(c1)COc1c[c-]c(cn1)-c1ccc(cn1)-c1ccccc1-3)CO2 |
| InChI | InChI=1S/C63H39N6O3.Ir/c1-4-10-55-49-28-50-30-51(29-49)57-12-6-3-9-54(57)45-15-21-60(66-33-45)48-18-24-63(69-36-48)72-39-42-26-40(37-70-61-22-16-46(34-67-61)58-19-13-43(31-64-58)52(55)7-1)25-41(27-42)38-71-62-23-17-47(35-68-62)59-20-14-44(32-65-59)53-8-2-5-11-56(50)53;/h1-15,19-36H,37-39H2;/q-3;+3 |
| InChIKey | IHNHBQFUWBZXEN-UHFFFAOYSA-N |
| XLogP | 13.82 |
| TPSA | 105.03 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | |
| Heavy Atoms | 73 |
| Complexity | — |
Lipinski Rule of Five
2 violations
| Rule | Value |
| MW ≤ 500 | 1120.26 |
| LogP ≤ 5 | 13.82 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|
Analyze CID 140838861 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 140838861?
The IUPAC name of CID 140838861 (CID 140838861) is not available.
What is the SMILES notation for CID 140838861?
The canonical SMILES for CID 140838861 is [Ir+3].[c-]1cc2ncc1-c1ccc(cn1)-c1ccccc1-c1cc3cc(c1)-c1ccccc1-c1ccc(nc1)-c1[c-]cc(nc1)OCc1cc(cc(c1)COc1c[c-]c(cn1)-c1ccc(cn1)-c1ccccc1-3)CO2.
What is the InChIKey of CID 140838861?
The InChIKey is IHNHBQFUWBZXEN-UHFFFAOYSA-N. The full InChI is InChI=1S/C63H39N6O3.Ir/c1-4-10-55-49-28-50-30-51(29-49)57-12-6-3-9-54(57)45-15-21-60(66-33-45)48-18-24-63(69-36-48)72-39-42-26-40(37-70-61-22-16-46(34-67-61)58-19-13-43(31-64-58)52(55)7-1)25-41(27-42)38-71-62-23-17-47(35-68-62)59-20-14-44(32-65-59)53-8-2-5-11-56(50)53;/h1-15,19-36H,37-39H2;/q-3;+3.
What are the key properties of CID 140838861?
CID 140838861 has a molecular weight of 1120.26 g/mol, XLogP of 13.82, 0 rotatable bonds, 0 hydrogen bond donors, and 9 hydrogen bond acceptors.
Where does this data come from?
All data for CID 140838861 is sourced from PubChem (CID 140838861), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).