C50H45BN4O2 — CID 140838939
2,4-bis(9,9-dimethylfluoren-3-yl)-6-[6-[4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]-3-pyridinyl]-1,3,5-triazine (PubChem CID 140838939) has the molecular formula C50H45BN4O2 and a molecular weight of 744.75 g/mol. Its IUPAC name is 2,4-bis(9,9-dimethylfluoren-3-yl)-6-[6-[4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]-3-pyridinyl]-1,3,5-triazine.
| Compound Name | 2,4-bis(9,9-dimethylfluoren-3-yl)-6-[6-[4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]-3-pyridinyl]-1,3,5-triazine |
|---|---|
| PubChem CID | 140838939 |
| Molecular Formula | C50H45BN4O2 |
| Molecular Weight | 744.75 g/mol |
| Exact Mass | 744.36 |
| IUPAC Name | 2,4-bis(9,9-dimethylfluoren-3-yl)-6-[6-[4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]-3-pyridinyl]-1,3,5-triazine |
| SMILES | CC1(C)c2ccccc2-c2cc(-c3nc(-c4ccc(-c5ccc(B6OC(C)(C)C(C)(C)O6)cc5)nc4)nc(-c4ccc5c(c4)-c4ccccc4C5(C)C)n3)ccc21 |
| InChI | InChI=1S/C50H45BN4O2/c1-47(2)39-15-11-9-13-35(39)37-27-31(19-24-41(37)47)44-53-45(32-20-25-42-38(28-32)36-14-10-12-16-40(36)48(42,3)4)55-46(54-44)33-21-26-43(52-29-33)30-17-22-34(23-18-30)51-56-49(5,6)50(7,8)57-51/h9-29H,1-8H3 |
| InChIKey | YRYABEGAGQHYML-UHFFFAOYSA-N |
| XLogP | 10.85 |
| TPSA | 70.02 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 57 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 744.75 |
| LogP ≤ 5 | 10.85 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|