C19H23NO2 — CID 140839199
ethyl (1S,12S,15R)-5,6-dimethyl-9-azatetracyclo[10.2.1.02,10.03,8]pentadeca-2(10),3(8),4,6-tetraene-15-carboxylate (PubChem CID 140839199) has the molecular formula C19H23NO2 and a molecular weight of 297.40 g/mol. Its IUPAC name is ethyl (1S,12S,15R)-5,6-dimethyl-9-azatetracyclo[10.2.1.02,10.03,8]pentadeca-2(10),3(8),4,6-tetraene-15-carboxylate.
| Compound Name | ethyl (1S,12S,15R)-5,6-dimethyl-9-azatetracyclo[10.2.1.02,10.03,8]pentadeca-2(10),3(8),4,6-tetraene-15-carboxylate |
|---|---|
| PubChem CID | 140839199 |
| Molecular Formula | C19H23NO2 |
| Molecular Weight | 297.40 g/mol |
| Exact Mass | 297.17 |
| IUPAC Name | ethyl (1S,12S,15R)-5,6-dimethyl-9-azatetracyclo[10.2.1.02,10.03,8]pentadeca-2(10),3(8),4,6-tetraene-15-carboxylate |
| SMILES | CCOC(=O)[C@@H]1[C@H]2CC[C@@H]1c1c([nH]c3cc(C)c(C)cc13)C2 |
| InChI | InChI=1S/C19H23NO2/c1-4-22-19(21)17-12-5-6-13(17)18-14-7-10(2)11(3)8-15(14)20-16(18)9-12/h7-8,12-13,17,20H,4-6,9H2,1-3H3/t12-,13-,17+/m0/s1 |
| InChIKey | IPMFRYMFPCIFBE-GDZNZVCISA-N |
| XLogP | 4.01 |
| TPSA | 42.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 297.40 |
| LogP ≤ 5 | 4.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|