C19H22N2OSi — CID 140839537
(2S)-1-(10,10-dimethylbenzo[b][1,4]benzoxasilin-3-yl)-2,3-dimethyl-2H-imidazole (PubChem CID 140839537) has the molecular formula C19H22N2OSi and a molecular weight of 322.48 g/mol. Its IUPAC name is (2S)-1-(10,10-dimethylbenzo[b][1,4]benzoxasilin-3-yl)-2,3-dimethyl-2H-imidazole.
| Compound Name | (2S)-1-(10,10-dimethylbenzo[b][1,4]benzoxasilin-3-yl)-2,3-dimethyl-2H-imidazole |
|---|---|
| PubChem CID | 140839537 |
| Molecular Formula | C19H22N2OSi |
| Molecular Weight | 322.48 g/mol |
| Exact Mass | 322.15 |
| IUPAC Name | (2S)-1-(10,10-dimethylbenzo[b][1,4]benzoxasilin-3-yl)-2,3-dimethyl-2H-imidazole |
| SMILES | C[C@H]1N(C)C=CN1c1ccc2c(c1)Oc1ccccc1[Si]2(C)C |
| InChI | InChI=1S/C19H22N2OSi/c1-14-20(2)11-12-21(14)15-9-10-19-17(13-15)22-16-7-5-6-8-18(16)23(19,3)4/h5-14H,1-4H3/t14-/m0/s1 |
| InChIKey | DCCCLNPBCPZKCU-AWEZNQCLSA-N |
| XLogP | 3.18 |
| TPSA | 15.71 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 322.48 |
| LogP ≤ 5 | 3.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|