C15H36MoN4 — CID 140839998
bis(tert-butylimino)molybdenum(2+);ethyl(methyl)azanide;methyl(propan-2-yl)azanide (PubChem CID 140839998) has the molecular formula C15H36MoN4 and a molecular weight of 368.42 g/mol. Its IUPAC name is bis(tert-butylimino)molybdenum(2+);ethyl(methyl)azanide;methyl(propan-2-yl)azanide.
| Compound Name | bis(tert-butylimino)molybdenum(2+);ethyl(methyl)azanide;methyl(propan-2-yl)azanide |
|---|---|
| PubChem CID | 140839998 |
| Molecular Formula | C15H36MoN4 |
| Molecular Weight | 368.42 g/mol |
| Exact Mass | 370.20 |
| IUPAC Name | bis(tert-butylimino)molybdenum(2+);ethyl(methyl)azanide;methyl(propan-2-yl)azanide |
| SMILES | CC(C)(C)N=[Mo+2]=NC(C)(C)C.CC[N-]C.C[N-]C(C)C |
| InChI | InChI=1S/C4H10N.2C4H9N.C3H8N.Mo/c1-4(2)5-3;2*1-4(2,3)5;1-3-4-2;/h4H,1-3H3;2*1-3H3;3H2,1-2H3;/q-1;;;-1;+2 |
| InChIKey | SPQBBBDUFQJJRH-UHFFFAOYSA-N |
| XLogP | 5.44 |
| TPSA | 52.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.42 |
| LogP ≤ 5 | 5.44 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |