About bis(tert-butylimino)molybdenum(2+);ethyl(methyl)azanide;methyl(propan-2-yl)azanide
bis(tert-butylimino)molybdenum(2+);ethyl(methyl)azanide;methyl(propan-2-yl)azanide (PubChem CID 140839998) has the molecular formula C15H36MoN4
and a molecular weight of 368.42 g/mol. Its IUPAC name is bis(tert-butylimino)molybdenum(2+);ethyl(methyl)azanide;methyl(propan-2-yl)azanide.
Molecular Properties
| Compound Name | bis(tert-butylimino)molybdenum(2+);ethyl(methyl)azanide;methyl(propan-2-yl)azanide |
| PubChem CID | 140839998 |
| Molecular Formula | C15H36MoN4 |
| Molecular Weight | 368.42 g/mol |
| Exact Mass | 370.20 |
| IUPAC Name | bis(tert-butylimino)molybdenum(2+);ethyl(methyl)azanide;methyl(propan-2-yl)azanide |
| SMILES | CC(C)(C)N=[Mo+2]=NC(C)(C)C.CC[N-]C.C[N-]C(C)C |
| InChI | InChI=1S/C4H10N.2C4H9N.C3H8N.Mo/c1-4(2)5-3;2*1-4(2,3)5;1-3-4-2;/h4H,1-3H3;2*1-3H3;3H2,1-2H3;/q-1;;;-1;+2 |
| InChIKey | SPQBBBDUFQJJRH-UHFFFAOYSA-N |
| XLogP | 5.44 |
| TPSA | 52.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 368.42 |
| LogP ≤ 5 | 5.44 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze bis(tert-butylimino)molybdenum(2+);ethyl(methyl)azanide;methyl(propan-2-yl)azanide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of bis(tert-butylimino)molybdenum(2+);ethyl(methyl)azanide;methyl(propan-2-yl)azanide?
The IUPAC name of bis(tert-butylimino)molybdenum(2+);ethyl(methyl)azanide;methyl(propan-2-yl)azanide (CID 140839998) is bis(tert-butylimino)molybdenum(2+);ethyl(methyl)azanide;methyl(propan-2-yl)azanide.
What is the SMILES notation for bis(tert-butylimino)molybdenum(2+);ethyl(methyl)azanide;methyl(propan-2-yl)azanide?
The canonical SMILES for bis(tert-butylimino)molybdenum(2+);ethyl(methyl)azanide;methyl(propan-2-yl)azanide is CC(C)(C)N=[Mo+2]=NC(C)(C)C.CC[N-]C.C[N-]C(C)C.
What is the InChIKey of bis(tert-butylimino)molybdenum(2+);ethyl(methyl)azanide;methyl(propan-2-yl)azanide?
The InChIKey is SPQBBBDUFQJJRH-UHFFFAOYSA-N. The full InChI is InChI=1S/C4H10N.2C4H9N.C3H8N.Mo/c1-4(2)5-3;2*1-4(2,3)5;1-3-4-2;/h4H,1-3H3;2*1-3H3;3H2,1-2H3;/q-1;;;-1;+2.
What are the key properties of bis(tert-butylimino)molybdenum(2+);ethyl(methyl)azanide;methyl(propan-2-yl)azanide?
bis(tert-butylimino)molybdenum(2+);ethyl(methyl)azanide;methyl(propan-2-yl)azanide has a molecular weight of 368.42 g/mol, XLogP of 5.44, 2 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for bis(tert-butylimino)molybdenum(2+);ethyl(methyl)azanide;methyl(propan-2-yl)azanide is sourced from PubChem (CID 140839998), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).