C18H42MoN4 — CID 140840015
bis(2-methylbutan-2-ylimino)molybdenum(2+);tert-butyl(methyl)azanide;ethyl(methyl)azanide (PubChem CID 140840015) has the molecular formula C18H42MoN4 and a molecular weight of 410.50 g/mol. Its IUPAC name is bis(2-methylbutan-2-ylimino)molybdenum(2+);tert-butyl(methyl)azanide;ethyl(methyl)azanide.
| Compound Name | bis(2-methylbutan-2-ylimino)molybdenum(2+);tert-butyl(methyl)azanide;ethyl(methyl)azanide |
|---|---|
| PubChem CID | 140840015 |
| Molecular Formula | C18H42MoN4 |
| Molecular Weight | 410.50 g/mol |
| Exact Mass | 412.25 |
| IUPAC Name | bis(2-methylbutan-2-ylimino)molybdenum(2+);tert-butyl(methyl)azanide;ethyl(methyl)azanide |
| SMILES | CCC(C)(C)N=[Mo+2]=NC(C)(C)CC.CC[N-]C.C[N-]C(C)(C)C |
| InChI | InChI=1S/C5H12N.2C5H11N.C3H8N.Mo/c1-5(2,3)6-4;2*1-4-5(2,3)6;1-3-4-2;/h1-4H3;2*4H2,1-3H3;3H2,1-2H3;/q-1;;;-1;+2 |
| InChIKey | OPDFCLZJKALFHV-UHFFFAOYSA-N |
| XLogP | 6.61 |
| TPSA | 52.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.50 |
| LogP ≤ 5 | 6.61 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |