About bis(2-methylbutan-2-ylimino)molybdenum(2+);tert-butyl(methyl)azanide;ethyl(methyl)azanide
bis(2-methylbutan-2-ylimino)molybdenum(2+);tert-butyl(methyl)azanide;ethyl(methyl)azanide (PubChem CID 140840015) has the molecular formula C18H42MoN4
and a molecular weight of 410.50 g/mol. Its IUPAC name is bis(2-methylbutan-2-ylimino)molybdenum(2+);tert-butyl(methyl)azanide;ethyl(methyl)azanide.
Molecular Properties
| Compound Name | bis(2-methylbutan-2-ylimino)molybdenum(2+);tert-butyl(methyl)azanide;ethyl(methyl)azanide |
| PubChem CID | 140840015 |
| Molecular Formula | C18H42MoN4 |
| Molecular Weight | 410.50 g/mol |
| Exact Mass | 412.25 |
| IUPAC Name | bis(2-methylbutan-2-ylimino)molybdenum(2+);tert-butyl(methyl)azanide;ethyl(methyl)azanide |
| SMILES | CCC(C)(C)N=[Mo+2]=NC(C)(C)CC.CC[N-]C.C[N-]C(C)(C)C |
| InChI | InChI=1S/C5H12N.2C5H11N.C3H8N.Mo/c1-5(2,3)6-4;2*1-4-5(2,3)6;1-3-4-2;/h1-4H3;2*4H2,1-3H3;3H2,1-2H3;/q-1;;;-1;+2 |
| InChIKey | OPDFCLZJKALFHV-UHFFFAOYSA-N |
| XLogP | 6.61 |
| TPSA | 52.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 410.50 |
| LogP ≤ 5 | 6.61 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze bis(2-methylbutan-2-ylimino)molybdenum(2+);tert-butyl(methyl)azanide;ethyl(methyl)azanide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of bis(2-methylbutan-2-ylimino)molybdenum(2+);tert-butyl(methyl)azanide;ethyl(methyl)azanide?
The IUPAC name of bis(2-methylbutan-2-ylimino)molybdenum(2+);tert-butyl(methyl)azanide;ethyl(methyl)azanide (CID 140840015) is bis(2-methylbutan-2-ylimino)molybdenum(2+);tert-butyl(methyl)azanide;ethyl(methyl)azanide.
What is the SMILES notation for bis(2-methylbutan-2-ylimino)molybdenum(2+);tert-butyl(methyl)azanide;ethyl(methyl)azanide?
The canonical SMILES for bis(2-methylbutan-2-ylimino)molybdenum(2+);tert-butyl(methyl)azanide;ethyl(methyl)azanide is CCC(C)(C)N=[Mo+2]=NC(C)(C)CC.CC[N-]C.C[N-]C(C)(C)C.
What is the InChIKey of bis(2-methylbutan-2-ylimino)molybdenum(2+);tert-butyl(methyl)azanide;ethyl(methyl)azanide?
The InChIKey is OPDFCLZJKALFHV-UHFFFAOYSA-N. The full InChI is InChI=1S/C5H12N.2C5H11N.C3H8N.Mo/c1-5(2,3)6-4;2*1-4-5(2,3)6;1-3-4-2;/h1-4H3;2*4H2,1-3H3;3H2,1-2H3;/q-1;;;-1;+2.
What are the key properties of bis(2-methylbutan-2-ylimino)molybdenum(2+);tert-butyl(methyl)azanide;ethyl(methyl)azanide?
bis(2-methylbutan-2-ylimino)molybdenum(2+);tert-butyl(methyl)azanide;ethyl(methyl)azanide has a molecular weight of 410.50 g/mol, XLogP of 6.61, 5 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for bis(2-methylbutan-2-ylimino)molybdenum(2+);tert-butyl(methyl)azanide;ethyl(methyl)azanide is sourced from PubChem (CID 140840015), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).