About [1-[4-(6-amino-4-phenyl-3-pyridinyl)phenyl]-3-hydroxy-3-methylcyclobutyl] N-tert-butylcarbamate
[1-[4-(6-amino-4-phenyl-3-pyridinyl)phenyl]-3-hydroxy-3-methylcyclobutyl] N-tert-butylcarbamate (PubChem CID 140840597) has the molecular formula C27H31N3O3
and a molecular weight of 445.56 g/mol. Its IUPAC name is [1-[4-(6-amino-4-phenyl-3-pyridinyl)phenyl]-3-hydroxy-3-methylcyclobutyl] N-tert-butylcarbamate.
Molecular Properties
| Compound Name | [1-[4-(6-amino-4-phenyl-3-pyridinyl)phenyl]-3-hydroxy-3-methylcyclobutyl] N-tert-butylcarbamate |
| PubChem CID | 140840597 |
| Molecular Formula | C27H31N3O3 |
| Molecular Weight | 445.56 g/mol |
| Exact Mass | 445.24 |
| IUPAC Name | [1-[4-(6-amino-4-phenyl-3-pyridinyl)phenyl]-3-hydroxy-3-methylcyclobutyl] N-tert-butylcarbamate |
| SMILES | CC1(O)CC(OC(=O)NC(C)(C)C)(c2ccc(-c3cnc(N)cc3-c3ccccc3)cc2)C1 |
| InChI | InChI=1S/C27H31N3O3/c1-25(2,3)30-24(31)33-27(16-26(4,32)17-27)20-12-10-19(11-13-20)22-15-29-23(28)14-21(22)18-8-6-5-7-9-18/h5-15,32H,16-17H2,1-4H3,(H2,28,29)(H,30,31) |
| InChIKey | YBMXKPHNDNOTPD-UHFFFAOYSA-N |
| XLogP | 5.26 |
| TPSA | 97.47 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 33 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 445.56 |
| LogP ≤ 5 | 5.26 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze [1-[4-(6-amino-4-phenyl-3-pyridinyl)phenyl]-3-hydroxy-3-methylcyclobutyl] N-tert-butylcarbamate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [1-[4-(6-amino-4-phenyl-3-pyridinyl)phenyl]-3-hydroxy-3-methylcyclobutyl] N-tert-butylcarbamate?
The IUPAC name of [1-[4-(6-amino-4-phenyl-3-pyridinyl)phenyl]-3-hydroxy-3-methylcyclobutyl] N-tert-butylcarbamate (CID 140840597) is [1-[4-(6-amino-4-phenyl-3-pyridinyl)phenyl]-3-hydroxy-3-methylcyclobutyl] N-tert-butylcarbamate.
What is the SMILES notation for [1-[4-(6-amino-4-phenyl-3-pyridinyl)phenyl]-3-hydroxy-3-methylcyclobutyl] N-tert-butylcarbamate?
The canonical SMILES for [1-[4-(6-amino-4-phenyl-3-pyridinyl)phenyl]-3-hydroxy-3-methylcyclobutyl] N-tert-butylcarbamate is CC1(O)CC(OC(=O)NC(C)(C)C)(c2ccc(-c3cnc(N)cc3-c3ccccc3)cc2)C1.
What is the InChIKey of [1-[4-(6-amino-4-phenyl-3-pyridinyl)phenyl]-3-hydroxy-3-methylcyclobutyl] N-tert-butylcarbamate?
The InChIKey is YBMXKPHNDNOTPD-UHFFFAOYSA-N. The full InChI is InChI=1S/C27H31N3O3/c1-25(2,3)30-24(31)33-27(16-26(4,32)17-27)20-12-10-19(11-13-20)22-15-29-23(28)14-21(22)18-8-6-5-7-9-18/h5-15,32H,16-17H2,1-4H3,(H2,28,29)(H,30,31).
What are the key properties of [1-[4-(6-amino-4-phenyl-3-pyridinyl)phenyl]-3-hydroxy-3-methylcyclobutyl] N-tert-butylcarbamate?
[1-[4-(6-amino-4-phenyl-3-pyridinyl)phenyl]-3-hydroxy-3-methylcyclobutyl] N-tert-butylcarbamate has a molecular weight of 445.56 g/mol, XLogP of 5.26, 4 rotatable bonds, 3 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for [1-[4-(6-amino-4-phenyl-3-pyridinyl)phenyl]-3-hydroxy-3-methylcyclobutyl] N-tert-butylcarbamate is sourced from PubChem (CID 140840597), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).