C8H14O2S — CID 140841121
2,6-dideuteriooxy-9-thiabicyclo[3.3.1]nonane (PubChem CID 140841121) has the molecular formula C8H14O2S and a molecular weight of 176.28 g/mol. Its IUPAC name is 2,6-dideuteriooxy-9-thiabicyclo[3.3.1]nonane.
| Compound Name | 2,6-dideuteriooxy-9-thiabicyclo[3.3.1]nonane |
|---|---|
| PubChem CID | 140841121 |
| Molecular Formula | C8H14O2S |
| Molecular Weight | 176.28 g/mol |
| Exact Mass | 176.08 |
| IUPAC Name | 2,6-dideuteriooxy-9-thiabicyclo[3.3.1]nonane |
| SMILES | [2H]OC1CCC2SC1CCC2O[2H] |
| InChI | InChI=1S/C8H14O2S/c9-5-1-3-7-6(10)2-4-8(5)11-7/h5-10H,1-4H2/i9D,10D |
| InChIKey | YWPNTOFLNJJRGE-QDRJLNDYSA-N |
| XLogP | 0.77 |
| TPSA | 40.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 176.28 |
| LogP ≤ 5 | 0.77 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |