About 5-Chloro-N3-(3-(trifluoro-methyl)phenyl) benzo[b] thiophene-2,3-diamine hydrochloride
5-Chloro-N3-(3-(trifluoro-methyl)phenyl) benzo[b] thiophene-2,3-diamine hydrochloride (PubChem CID 140841359) has the molecular formula C15H9ClF3N2S
and a molecular weight of 341.77 g/mol.
Molecular Properties
| Compound Name | 5-Chloro-N3-(3-(trifluoro-methyl)phenyl) benzo[b] thiophene-2,3-diamine hydrochloride |
| PubChem CID | 140841359 |
| Molecular Formula | C15H9ClF3N2S |
| Molecular Weight | 341.77 g/mol |
| Exact Mass | 341.01 |
| IUPAC Name | — |
| SMILES | [NH]c1sc2ccc(Cl)cc2c1Nc1cccc(C(F)(F)F)c1 |
| InChI | InChI=1S/C15H9ClF3N2S/c16-9-4-5-12-11(7-9)13(14(20)22-12)21-10-3-1-2-8(6-10)15(17,18)19/h1-7,20-21H |
| InChIKey | SMPXGHKKLCZPKJ-UHFFFAOYSA-N |
| XLogP | 6.23 |
| TPSA | 35.83 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 341.77 |
| LogP ≤ 5 | 6.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 5-Chloro-N3-(3-(trifluoro-methyl)phenyl) benzo[b] thiophene-2,3-diamine hydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-Chloro-N3-(3-(trifluoro-methyl)phenyl) benzo[b] thiophene-2,3-diamine hydrochloride?
The IUPAC name of 5-Chloro-N3-(3-(trifluoro-methyl)phenyl) benzo[b] thiophene-2,3-diamine hydrochloride (CID 140841359) is not available.
What is the SMILES notation for 5-Chloro-N3-(3-(trifluoro-methyl)phenyl) benzo[b] thiophene-2,3-diamine hydrochloride?
The canonical SMILES for 5-Chloro-N3-(3-(trifluoro-methyl)phenyl) benzo[b] thiophene-2,3-diamine hydrochloride is [NH]c1sc2ccc(Cl)cc2c1Nc1cccc(C(F)(F)F)c1.
What is the InChIKey of 5-Chloro-N3-(3-(trifluoro-methyl)phenyl) benzo[b] thiophene-2,3-diamine hydrochloride?
The InChIKey is SMPXGHKKLCZPKJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H9ClF3N2S/c16-9-4-5-12-11(7-9)13(14(20)22-12)21-10-3-1-2-8(6-10)15(17,18)19/h1-7,20-21H.
What are the key properties of 5-Chloro-N3-(3-(trifluoro-methyl)phenyl) benzo[b] thiophene-2,3-diamine hydrochloride?
5-Chloro-N3-(3-(trifluoro-methyl)phenyl) benzo[b] thiophene-2,3-diamine hydrochloride has a molecular weight of 341.77 g/mol, XLogP of 6.23, 2 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 5-Chloro-N3-(3-(trifluoro-methyl)phenyl) benzo[b] thiophene-2,3-diamine hydrochloride is sourced from PubChem (CID 140841359), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).