C14H17BFN2O2+ — CID 140842245
3-fluoro-1-methyl-6-(4,5,5-trimethyl-4-methyl-1,3,2-dioxaborolan-2-yl)indazole (PubChem CID 140842245) has the molecular formula C14H17BFN2O2+ and a molecular weight of 275.11 g/mol. Its IUPAC name is 3-fluoro-1-methyl-6-(4,5,5-trimethyl-4-methyl-1,3,2-dioxaborolan-2-yl)indazole.
| Compound Name | 3-fluoro-1-methyl-6-(4,5,5-trimethyl-4-methyl-1,3,2-dioxaborolan-2-yl)indazole |
|---|---|
| PubChem CID | 140842245 |
| Molecular Formula | C14H17BFN2O2+ |
| Molecular Weight | 275.11 g/mol |
| Exact Mass | 275.14 |
| IUPAC Name | 3-fluoro-1-methyl-6-(4,5,5-trimethyl-4-methyl-1,3,2-dioxaborolan-2-yl)indazole |
| SMILES | [CH2+]C1(C)OB(c2ccc3c(F)nn(C)c3c2)OC1(C)C |
| InChI | InChI=1S/C14H17BFN2O2/c1-13(2)14(3,4)20-15(19-13)9-6-7-10-11(8-9)18(5)17-12(10)16/h6-8H,1H2,2-5H3/q+1 |
| InChIKey | AFFPRNRGSHWQFB-UHFFFAOYSA-N |
| XLogP | 1.83 |
| TPSA | 36.28 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 275.11 |
| LogP ≤ 5 | 1.83 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|