C12H19NO — CID 140843858
1-[(2,2,6,6-tetradeuteriocyclohex-3-en-1-yl)methyl]piperidin-4-one (PubChem CID 140843858) has the molecular formula C12H19NO and a molecular weight of 197.31 g/mol. Its IUPAC name is 1-[(2,2,6,6-tetradeuteriocyclohex-3-en-1-yl)methyl]piperidin-4-one.
| Compound Name | 1-[(2,2,6,6-tetradeuteriocyclohex-3-en-1-yl)methyl]piperidin-4-one |
|---|---|
| PubChem CID | 140843858 |
| Molecular Formula | C12H19NO |
| Molecular Weight | 197.31 g/mol |
| Exact Mass | 197.17 |
| IUPAC Name | 1-[(2,2,6,6-tetradeuteriocyclohex-3-en-1-yl)methyl]piperidin-4-one |
| SMILES | [2H]C1([2H])C=CCC([2H])([2H])C1CN1CCC(=O)CC1 |
| InChI | InChI=1S/C12H19NO/c14-12-6-8-13(9-7-12)10-11-4-2-1-3-5-11/h1-2,11H,3-10H2/i4D2,5D2 |
| InChIKey | QJGDMWXEPIGMJZ-CQOLUAMGSA-N |
| XLogP | 2.01 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 197.31 |
| LogP ≤ 5 | 2.01 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|