C16H26N2O — CID 140843860
5-methyl-2-propan-2-yloxy-4-(2,2,6-trideuterio-6-methylpiperidin-4-yl)aniline (PubChem CID 140843860) has the molecular formula C16H26N2O and a molecular weight of 265.42 g/mol. Its IUPAC name is 5-methyl-2-propan-2-yloxy-4-(2,2,6-trideuterio-6-methylpiperidin-4-yl)aniline.
| Compound Name | 5-methyl-2-propan-2-yloxy-4-(2,2,6-trideuterio-6-methylpiperidin-4-yl)aniline |
|---|---|
| PubChem CID | 140843860 |
| Molecular Formula | C16H26N2O |
| Molecular Weight | 265.42 g/mol |
| Exact Mass | 265.22 |
| IUPAC Name | 5-methyl-2-propan-2-yloxy-4-(2,2,6-trideuterio-6-methylpiperidin-4-yl)aniline |
| SMILES | [2H]C1([2H])CC(c2cc(OC(C)C)c(N)cc2C)CC([2H])(C)N1 |
| InChI | InChI=1S/C16H26N2O/c1-10(2)19-16-9-14(11(3)7-15(16)17)13-5-6-18-12(4)8-13/h7,9-10,12-13,18H,5-6,8,17H2,1-4H3/i6D2,12D |
| InChIKey | YZUBKHZNAVBMQN-GUJSMHJNSA-N |
| XLogP | 3.22 |
| TPSA | 47.28 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 265.42 |
| LogP ≤ 5 | 3.22 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|