About [7-acetyloxy-5-[hydroxy(dimethyl)silyl]oxy-2,8-dimethylnonan-3-yl] acetate
[7-acetyloxy-5-[hydroxy(dimethyl)silyl]oxy-2,8-dimethylnonan-3-yl] acetate (PubChem CID 140844082) has the molecular formula C17H34O6Si
and a molecular weight of 362.54 g/mol. Its IUPAC name is [7-acetyloxy-5-[hydroxy(dimethyl)silyl]oxy-2,8-dimethylnonan-3-yl] acetate.
Molecular Properties
| Compound Name | [7-acetyloxy-5-[hydroxy(dimethyl)silyl]oxy-2,8-dimethylnonan-3-yl] acetate |
| PubChem CID | 140844082 |
| Molecular Formula | C17H34O6Si |
| Molecular Weight | 362.54 g/mol |
| Exact Mass | 362.21 |
| IUPAC Name | [7-acetyloxy-5-[hydroxy(dimethyl)silyl]oxy-2,8-dimethylnonan-3-yl] acetate |
| SMILES | CC(=O)OC(CC(CC(OC(C)=O)C(C)C)O[Si](C)(C)O)C(C)C |
| InChI | InChI=1S/C17H34O6Si/c1-11(2)16(21-13(5)18)9-15(23-24(7,8)20)10-17(12(3)4)22-14(6)19/h11-12,15-17,20H,9-10H2,1-8H3 |
| InChIKey | SWWYXJAQGGKLCV-UHFFFAOYSA-N |
| XLogP | 3.02 |
| TPSA | 82.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 362.54 |
| LogP ≤ 5 | 3.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze [7-acetyloxy-5-[hydroxy(dimethyl)silyl]oxy-2,8-dimethylnonan-3-yl] acetate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [7-acetyloxy-5-[hydroxy(dimethyl)silyl]oxy-2,8-dimethylnonan-3-yl] acetate?
The IUPAC name of [7-acetyloxy-5-[hydroxy(dimethyl)silyl]oxy-2,8-dimethylnonan-3-yl] acetate (CID 140844082) is [7-acetyloxy-5-[hydroxy(dimethyl)silyl]oxy-2,8-dimethylnonan-3-yl] acetate.
What is the SMILES notation for [7-acetyloxy-5-[hydroxy(dimethyl)silyl]oxy-2,8-dimethylnonan-3-yl] acetate?
The canonical SMILES for [7-acetyloxy-5-[hydroxy(dimethyl)silyl]oxy-2,8-dimethylnonan-3-yl] acetate is CC(=O)OC(CC(CC(OC(C)=O)C(C)C)O[Si](C)(C)O)C(C)C.
What is the InChIKey of [7-acetyloxy-5-[hydroxy(dimethyl)silyl]oxy-2,8-dimethylnonan-3-yl] acetate?
The InChIKey is SWWYXJAQGGKLCV-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H34O6Si/c1-11(2)16(21-13(5)18)9-15(23-24(7,8)20)10-17(12(3)4)22-14(6)19/h11-12,15-17,20H,9-10H2,1-8H3.
What are the key properties of [7-acetyloxy-5-[hydroxy(dimethyl)silyl]oxy-2,8-dimethylnonan-3-yl] acetate?
[7-acetyloxy-5-[hydroxy(dimethyl)silyl]oxy-2,8-dimethylnonan-3-yl] acetate has a molecular weight of 362.54 g/mol, XLogP of 3.02, 10 rotatable bonds, 1 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for [7-acetyloxy-5-[hydroxy(dimethyl)silyl]oxy-2,8-dimethylnonan-3-yl] acetate is sourced from PubChem (CID 140844082), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).