About 2-hydroxy-3,4-dihydrooxaborinino[5,6-b]pyridine-8-carboxylic acid
2-hydroxy-3,4-dihydrooxaborinino[5,6-b]pyridine-8-carboxylic acid (PubChem CID 140844807) has the molecular formula C8H8BNO4
and a molecular weight of 192.97 g/mol. Its IUPAC name is 2-hydroxy-3,4-dihydrooxaborinino[5,6-b]pyridine-8-carboxylic acid.
Molecular Properties
| Compound Name | 2-hydroxy-3,4-dihydrooxaborinino[5,6-b]pyridine-8-carboxylic acid |
| PubChem CID | 140844807 |
| Molecular Formula | C8H8BNO4 |
| Molecular Weight | 192.97 g/mol |
| Exact Mass | 193.05 |
| IUPAC Name | 2-hydroxy-3,4-dihydrooxaborinino[5,6-b]pyridine-8-carboxylic acid |
| SMILES | O=C(O)c1ccnc2c1OB(O)CC2 |
| InChI | InChI=1S/C8H8BNO4/c11-8(12)5-2-4-10-6-1-3-9(13)14-7(5)6/h2,4,13H,1,3H2,(H,11,12) |
| InChIKey | YFCVPKOIHTVLNL-UHFFFAOYSA-N |
| XLogP | 0.20 |
| TPSA | 79.65 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 192.97 |
| LogP ≤ 5 | 0.20 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze 2-hydroxy-3,4-dihydrooxaborinino[5,6-b]pyridine-8-carboxylic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-hydroxy-3,4-dihydrooxaborinino[5,6-b]pyridine-8-carboxylic acid?
The IUPAC name of 2-hydroxy-3,4-dihydrooxaborinino[5,6-b]pyridine-8-carboxylic acid (CID 140844807) is 2-hydroxy-3,4-dihydrooxaborinino[5,6-b]pyridine-8-carboxylic acid.
What is the SMILES notation for 2-hydroxy-3,4-dihydrooxaborinino[5,6-b]pyridine-8-carboxylic acid?
The canonical SMILES for 2-hydroxy-3,4-dihydrooxaborinino[5,6-b]pyridine-8-carboxylic acid is O=C(O)c1ccnc2c1OB(O)CC2.
What is the InChIKey of 2-hydroxy-3,4-dihydrooxaborinino[5,6-b]pyridine-8-carboxylic acid?
The InChIKey is YFCVPKOIHTVLNL-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H8BNO4/c11-8(12)5-2-4-10-6-1-3-9(13)14-7(5)6/h2,4,13H,1,3H2,(H,11,12).
What are the key properties of 2-hydroxy-3,4-dihydrooxaborinino[5,6-b]pyridine-8-carboxylic acid?
2-hydroxy-3,4-dihydrooxaborinino[5,6-b]pyridine-8-carboxylic acid has a molecular weight of 192.97 g/mol, XLogP of 0.20, 1 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-hydroxy-3,4-dihydrooxaborinino[5,6-b]pyridine-8-carboxylic acid is sourced from PubChem (CID 140844807), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).