C52H40N2OSi — CID 140845180
4-[10,10-dimethyl-3-[4-(N-phenylanilino)phenyl]-[1]benzosilolo[3,2-b][1]benzofuran-8-yl]-N,N-diphenylaniline (PubChem CID 140845180) has the molecular formula C52H40N2OSi and a molecular weight of 736.99 g/mol. Its IUPAC name is 4-[10,10-dimethyl-3-[4-(N-phenylanilino)phenyl]-[1]benzosilolo[3,2-b][1]benzofuran-8-yl]-N,N-diphenylaniline.
| Compound Name | 4-[10,10-dimethyl-3-[4-(N-phenylanilino)phenyl]-[1]benzosilolo[3,2-b][1]benzofuran-8-yl]-N,N-diphenylaniline |
|---|---|
| PubChem CID | 140845180 |
| Molecular Formula | C52H40N2OSi |
| Molecular Weight | 736.99 g/mol |
| Exact Mass | 736.29 |
| IUPAC Name | 4-[10,10-dimethyl-3-[4-(N-phenylanilino)phenyl]-[1]benzosilolo[3,2-b][1]benzofuran-8-yl]-N,N-diphenylaniline |
| SMILES | C[Si]1(C)c2ccc(-c3ccc(N(c4ccccc4)c4ccccc4)cc3)cc2-c2oc3ccc(-c4ccc(N(c5ccccc5)c5ccccc5)cc4)cc3c21 |
| InChI | InChI=1S/C52H40N2OSi/c1-56(2)50-34-28-40(38-25-31-46(32-26-38)54(43-19-11-5-12-20-43)44-21-13-6-14-22-44)36-48(50)51-52(56)47-35-39(27-33-49(47)55-51)37-23-29-45(30-24-37)53(41-15-7-3-8-16-41)42-17-9-4-10-18-42/h3-36H,1-2H3 |
| InChIKey | NOLDIOHICPZCDT-UHFFFAOYSA-N |
| XLogP | 13.51 |
| TPSA | 19.62 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 56 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 736.99 |
| LogP ≤ 5 | 13.51 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|