C26H29ClO2Si — CID 140845769
(1S,2S)-1-[tert-butyl(diphenyl)silyl]oxy-8-chloro-1,2,3,4-tetrahydronaphthalen-2-ol (PubChem CID 140845769) has the molecular formula C26H29ClO2Si and a molecular weight of 437.06 g/mol. Its IUPAC name is (1S,2S)-1-[tert-butyl(diphenyl)silyl]oxy-8-chloro-1,2,3,4-tetrahydronaphthalen-2-ol.
| Compound Name | (1S,2S)-1-[tert-butyl(diphenyl)silyl]oxy-8-chloro-1,2,3,4-tetrahydronaphthalen-2-ol |
|---|---|
| PubChem CID | 140845769 |
| Molecular Formula | C26H29ClO2Si |
| Molecular Weight | 437.06 g/mol |
| Exact Mass | 436.16 |
| IUPAC Name | (1S,2S)-1-[tert-butyl(diphenyl)silyl]oxy-8-chloro-1,2,3,4-tetrahydronaphthalen-2-ol |
| SMILES | CC(C)(C)[Si](O[C@H]1c2c(Cl)cccc2CC[C@@H]1O)(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C26H29ClO2Si/c1-26(2,3)30(20-12-6-4-7-13-20,21-14-8-5-9-15-21)29-25-23(28)18-17-19-11-10-16-22(27)24(19)25/h4-16,23,25,28H,17-18H2,1-3H3/t23-,25+/m0/s1 |
| InChIKey | KNIYPSZZNSTGTK-UKILVPOCSA-N |
| XLogP | 5.26 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 437.06 |
| LogP ≤ 5 | 5.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|