C21H23F3N4O2 — CID 140845798
[8-methyl-3-[[2-methyl-3-(trifluoromethyl)phenyl]methyl]-6-(2,2,3,3,5,5,6,6-octadeuteriomorpholin-4-yl)imidazo[1,2-b]pyridazin-2-yl]methanol (PubChem CID 140845798) has the molecular formula C21H23F3N4O2 and a molecular weight of 428.48 g/mol. Its IUPAC name is [8-methyl-3-[[2-methyl-3-(trifluoromethyl)phenyl]methyl]-6-(2,2,3,3,5,5,6,6-octadeuteriomorpholin-4-yl)imidazo[1,2-b]pyridazin-2-yl]methanol.
| Compound Name | [8-methyl-3-[[2-methyl-3-(trifluoromethyl)phenyl]methyl]-6-(2,2,3,3,5,5,6,6-octadeuteriomorpholin-4-yl)imidazo[1,2-b]pyridazin-2-yl]methanol |
|---|---|
| PubChem CID | 140845798 |
| Molecular Formula | C21H23F3N4O2 |
| Molecular Weight | 428.48 g/mol |
| Exact Mass | 428.23 |
| IUPAC Name | [8-methyl-3-[[2-methyl-3-(trifluoromethyl)phenyl]methyl]-6-(2,2,3,3,5,5,6,6-octadeuteriomorpholin-4-yl)imidazo[1,2-b]pyridazin-2-yl]methanol |
| SMILES | [2H]C1([2H])OC([2H])([2H])C([2H])([2H])N(c2cc(C)c3nc(CO)c(Cc4cccc(C(F)(F)F)c4C)n3n2)C1([2H])[2H] |
| InChI | InChI=1S/C21H23F3N4O2/c1-13-10-19(27-6-8-30-9-7-27)26-28-18(17(12-29)25-20(13)28)11-15-4-3-5-16(14(15)2)21(22,23)24/h3-5,10,29H,6-9,11-12H2,1-2H3/i6D2,7D2,8D2,9D2 |
| InChIKey | NVDWMDNGWKJSTQ-COMRDEPKSA-N |
| XLogP | 3.28 |
| TPSA | 62.89 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 428.48 |
| LogP ≤ 5 | 3.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |