C33H44FN9O4 — CID 140845873
tert-butyl (3R,4R)-3-fluoro-4-[[8-propan-2-yl-4-[[3-[(1-prop-2-enoylpyrrolidine-3-carbonyl)amino]phenyl]methylamino]pyrazolo[1,5-a][1,3,5]triazin-2-yl]amino]piperidine-1-carboxylate (PubChem CID 140845873) has the molecular formula C33H44FN9O4 and a molecular weight of 649.77 g/mol. Its IUPAC name is tert-butyl (3R,4R)-3-fluoro-4-[[8-propan-2-yl-4-[[3-[(1-prop-2-enoylpyrrolidine-3-carbonyl)amino]phenyl]methylamino]pyrazolo[1,5-a][1,3,5]triazin-2-yl]amino]piperidine-1-carboxylate.
| Compound Name | tert-butyl (3R,4R)-3-fluoro-4-[[8-propan-2-yl-4-[[3-[(1-prop-2-enoylpyrrolidine-3-carbonyl)amino]phenyl]methylamino]pyrazolo[1,5-a][1,3,5]triazin-2-yl]amino]piperidine-1-carboxylate |
|---|---|
| PubChem CID | 140845873 |
| Molecular Formula | C33H44FN9O4 |
| Molecular Weight | 649.77 g/mol |
| Exact Mass | 649.35 |
| IUPAC Name | tert-butyl (3R,4R)-3-fluoro-4-[[8-propan-2-yl-4-[[3-[(1-prop-2-enoylpyrrolidine-3-carbonyl)amino]phenyl]methylamino]pyrazolo[1,5-a][1,3,5]triazin-2-yl]amino]piperidine-1-carboxylate |
| SMILES | C=CC(=O)N1CCC(C(=O)Nc2cccc(CNc3nc(N[C@@H]4CCN(C(=O)OC(C)(C)C)C[C@H]4F)nc4c(C(C)C)cnn34)c2)C1 |
| InChI | InChI=1S/C33H44FN9O4/c1-7-27(44)41-13-11-22(18-41)29(45)37-23-10-8-9-21(15-23)16-35-31-40-30(39-28-24(20(2)3)17-36-43(28)31)38-26-12-14-42(19-25(26)34)32(46)47-33(4,5)6/h7-10,15,17,20,22,25-26H,1,11-14,16,18-19H2,2-6H3,(H,37,45)(H2,35,38,39,40)/t22?,25-,26-/m1/s1 |
| InChIKey | GQVYUCBCPSACOE-FLZRTACHSA-N |
| XLogP | 4.59 |
| TPSA | 146.09 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 47 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 649.77 |
| LogP ≤ 5 | 4.59 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|