C23H27FN6O2S — CID 140846133
(1R,3R)-3-[5-[3-(5-ethylpyrazin-2-yl)-1,2-oxazol-5-yl]-2-fluorophenyl]-3,6,6-trimethyl-1-oxo-1-(trideuteriomethylimino)-2H-1,4-thiazin-5-amine (PubChem CID 140846133) has the molecular formula C23H27FN6O2S and a molecular weight of 473.59 g/mol. Its IUPAC name is (1R,3R)-3-[5-[3-(5-ethylpyrazin-2-yl)-1,2-oxazol-5-yl]-2-fluorophenyl]-3,6,6-trimethyl-1-oxo-1-(trideuteriomethylimino)-2H-1,4-thiazin-5-amine.
| Compound Name | (1R,3R)-3-[5-[3-(5-ethylpyrazin-2-yl)-1,2-oxazol-5-yl]-2-fluorophenyl]-3,6,6-trimethyl-1-oxo-1-(trideuteriomethylimino)-2H-1,4-thiazin-5-amine |
|---|---|
| PubChem CID | 140846133 |
| Molecular Formula | C23H27FN6O2S |
| Molecular Weight | 473.59 g/mol |
| Exact Mass | 473.21 |
| IUPAC Name | (1R,3R)-3-[5-[3-(5-ethylpyrazin-2-yl)-1,2-oxazol-5-yl]-2-fluorophenyl]-3,6,6-trimethyl-1-oxo-1-(trideuteriomethylimino)-2H-1,4-thiazin-5-amine |
| SMILES | [2H]C([2H])([2H])N=[S@@]1(=O)C[C@@](C)(c2cc(-c3cc(-c4cnc(CC)cn4)no3)ccc2F)N=C(N)C1(C)C |
| InChI | InChI=1S/C23H27FN6O2S/c1-6-15-11-28-19(12-27-15)18-10-20(32-30-18)14-7-8-17(24)16(9-14)23(4)13-33(31,26-5)22(2,3)21(25)29-23/h7-12H,6,13H2,1-5H3,(H2,25,29)/t23-,33+/m0/s1/i5D3 |
| InChIKey | IMDXLANRYZZJTH-DYYADIMCSA-N |
| XLogP | 3.96 |
| TPSA | 119.62 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 473.59 |
| LogP ≤ 5 | 3.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |