C28H34N4O6Si — CID 140847400
(2S)-2-cyclopropyl-2-[[2-[2-oxo-3-(2-trimethylsilylethoxymethyl)-1,3-benzoxazol-5-yl]-9-oxa-1,3-diazatricyclo[6.4.1.04,13]trideca-2,4(13),5,7-tetraen-6-yl]amino]acetic acid (PubChem CID 140847400) has the molecular formula C28H34N4O6Si and a molecular weight of 550.69 g/mol. Its IUPAC name is (2S)-2-cyclopropyl-2-[[2-[2-oxo-3-(2-trimethylsilylethoxymethyl)-1,3-benzoxazol-5-yl]-9-oxa-1,3-diazatricyclo[6.4.1.04,13]trideca-2,4(13),5,7-tetraen-6-yl]amino]acetic acid.
| Compound Name | (2S)-2-cyclopropyl-2-[[2-[2-oxo-3-(2-trimethylsilylethoxymethyl)-1,3-benzoxazol-5-yl]-9-oxa-1,3-diazatricyclo[6.4.1.04,13]trideca-2,4(13),5,7-tetraen-6-yl]amino]acetic acid |
|---|---|
| PubChem CID | 140847400 |
| Molecular Formula | C28H34N4O6Si |
| Molecular Weight | 550.69 g/mol |
| Exact Mass | 550.22 |
| IUPAC Name | (2S)-2-cyclopropyl-2-[[2-[2-oxo-3-(2-trimethylsilylethoxymethyl)-1,3-benzoxazol-5-yl]-9-oxa-1,3-diazatricyclo[6.4.1.04,13]trideca-2,4(13),5,7-tetraen-6-yl]amino]acetic acid |
| SMILES | C[Si](C)(C)CCOCn1c(=O)oc2ccc(-c3nc4cc(N[C@H](C(=O)O)C5CC5)cc5c4n3CCCO5)cc21 |
| InChI | InChI=1S/C28H34N4O6Si/c1-39(2,3)12-11-36-16-32-21-13-18(7-8-22(21)38-28(32)35)26-30-20-14-19(29-24(27(33)34)17-5-6-17)15-23-25(20)31(26)9-4-10-37-23/h7-8,13-15,17,24,29H,4-6,9-12,16H2,1-3H3,(H,33,34)/t24-/m0/s1 |
| InChIKey | IAWQAPRMGNXORQ-DEOSSOPVSA-N |
| XLogP | 4.98 |
| TPSA | 120.75 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 550.69 |
| LogP ≤ 5 | 4.98 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|