C24H21N5OSi — CID 140848214
trimethyl-[2-[3-(1,3-oxazol-5-yl)-6-pyridin-2-yl-4H-imidazo[1,5-a][1,4]benzodiazepin-8-yl]ethynyl]silane (PubChem CID 140848214) has the molecular formula C24H21N5OSi and a molecular weight of 423.55 g/mol. Its IUPAC name is trimethyl-[2-[3-(1,3-oxazol-5-yl)-6-pyridin-2-yl-4H-imidazo[1,5-a][1,4]benzodiazepin-8-yl]ethynyl]silane.
| Compound Name | trimethyl-[2-[3-(1,3-oxazol-5-yl)-6-pyridin-2-yl-4H-imidazo[1,5-a][1,4]benzodiazepin-8-yl]ethynyl]silane |
|---|---|
| PubChem CID | 140848214 |
| Molecular Formula | C24H21N5OSi |
| Molecular Weight | 423.55 g/mol |
| Exact Mass | 423.15 |
| IUPAC Name | trimethyl-[2-[3-(1,3-oxazol-5-yl)-6-pyridin-2-yl-4H-imidazo[1,5-a][1,4]benzodiazepin-8-yl]ethynyl]silane |
| SMILES | C[Si](C)(C)C#Cc1ccc2c(c1)C(c1ccccn1)=NCc1c(-c3cnco3)ncn1-2 |
| InChI | InChI=1S/C24H21N5OSi/c1-31(2,3)11-9-17-7-8-20-18(12-17)23(19-6-4-5-10-26-19)27-13-21-24(28-15-29(20)21)22-14-25-16-30-22/h4-8,10,12,14-16H,13H2,1-3H3 |
| InChIKey | ZOSVUHWEALDINZ-UHFFFAOYSA-N |
| XLogP | 4.50 |
| TPSA | 69.10 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 423.55 |
| LogP ≤ 5 | 4.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|