C21H5N3O3S — CID 140848285
10-isocyano-13,15-dioxo-14-oxa-8-thiapentacyclo[10.6.2.02,7.09,19.016,20]icosa-1(19),2(7),3,5,9,11,16(20),17-octaene-4,18-dicarbonitrile (PubChem CID 140848285) has the molecular formula C21H5N3O3S and a molecular weight of 379.36 g/mol. Its IUPAC name is 10-isocyano-13,15-dioxo-14-oxa-8-thiapentacyclo[10.6.2.02,7.09,19.016,20]icosa-1(19),2(7),3,5,9,11,16(20),17-octaene-4,18-dicarbonitrile.
| Compound Name | 10-isocyano-13,15-dioxo-14-oxa-8-thiapentacyclo[10.6.2.02,7.09,19.016,20]icosa-1(19),2(7),3,5,9,11,16(20),17-octaene-4,18-dicarbonitrile |
|---|---|
| PubChem CID | 140848285 |
| Molecular Formula | C21H5N3O3S |
| Molecular Weight | 379.36 g/mol |
| Exact Mass | 379.01 |
| IUPAC Name | 10-isocyano-13,15-dioxo-14-oxa-8-thiapentacyclo[10.6.2.02,7.09,19.016,20]icosa-1(19),2(7),3,5,9,11,16(20),17-octaene-4,18-dicarbonitrile |
| SMILES | [C-]#[N+]c1cc2c(=O)oc(=O)c3cc(C#N)c4c5cc(C#N)ccc5sc1c4c23 |
| InChI | InChI=1S/C21H5N3O3S/c1-24-14-6-13-17-12(20(25)27-21(13)26)5-10(8-23)16-11-4-9(7-22)2-3-15(11)28-19(14)18(16)17/h2-6H |
| InChIKey | PMPBURFBLPFURR-UHFFFAOYSA-N |
| XLogP | 4.41 |
| TPSA | 99.22 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 379.36 |
| LogP ≤ 5 | 4.41 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|