C20H6N2O3S — CID 140848306
10-isocyano-13,15-dioxo-14-oxa-8-thiapentacyclo[10.6.2.02,7.09,19.016,20]icosa-1(19),2,4,6,9,11,16(20),17-octaene-18-carbonitrile (PubChem CID 140848306) has the molecular formula C20H6N2O3S and a molecular weight of 354.35 g/mol. Its IUPAC name is 10-isocyano-13,15-dioxo-14-oxa-8-thiapentacyclo[10.6.2.02,7.09,19.016,20]icosa-1(19),2,4,6,9,11,16(20),17-octaene-18-carbonitrile.
| Compound Name | 10-isocyano-13,15-dioxo-14-oxa-8-thiapentacyclo[10.6.2.02,7.09,19.016,20]icosa-1(19),2,4,6,9,11,16(20),17-octaene-18-carbonitrile |
|---|---|
| PubChem CID | 140848306 |
| Molecular Formula | C20H6N2O3S |
| Molecular Weight | 354.35 g/mol |
| Exact Mass | 354.01 |
| IUPAC Name | 10-isocyano-13,15-dioxo-14-oxa-8-thiapentacyclo[10.6.2.02,7.09,19.016,20]icosa-1(19),2,4,6,9,11,16(20),17-octaene-18-carbonitrile |
| SMILES | [C-]#[N+]c1cc2c(=O)oc(=O)c3cc(C#N)c4c5ccccc5sc1c4c23 |
| InChI | InChI=1S/C20H6N2O3S/c1-22-13-7-12-16-11(19(23)25-20(12)24)6-9(8-21)15-10-4-2-3-5-14(10)26-18(13)17(15)16/h2-7H |
| InChIKey | MTQMQELLMXMDQF-UHFFFAOYSA-N |
| XLogP | 4.53 |
| TPSA | 75.43 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.35 |
| LogP ≤ 5 | 4.53 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|