About 5,5-diphenyl-1-propan-2-yl-3-trimethylsilylimidazolidine-2,4-dione
5,5-diphenyl-1-propan-2-yl-3-trimethylsilylimidazolidine-2,4-dione (PubChem CID 140848569) has the molecular formula C21H26N2O2Si
and a molecular weight of 366.54 g/mol. Its IUPAC name is 5,5-diphenyl-1-propan-2-yl-3-trimethylsilylimidazolidine-2,4-dione.
Molecular Properties
| Compound Name | 5,5-diphenyl-1-propan-2-yl-3-trimethylsilylimidazolidine-2,4-dione |
| PubChem CID | 140848569 |
| Molecular Formula | C21H26N2O2Si |
| Molecular Weight | 366.54 g/mol |
| Exact Mass | 366.18 |
| IUPAC Name | 5,5-diphenyl-1-propan-2-yl-3-trimethylsilylimidazolidine-2,4-dione |
| SMILES | CC(C)N1C(=O)N([Si](C)(C)C)C(=O)C1(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C21H26N2O2Si/c1-16(2)22-20(25)23(26(3,4)5)19(24)21(22,17-12-8-6-9-13-17)18-14-10-7-11-15-18/h6-16H,1-5H3 |
| InChIKey | VMLZOLVQGMFIGW-UHFFFAOYSA-N |
| XLogP | 4.44 |
| TPSA | 40.62 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 366.54 |
| LogP ≤ 5 | 4.44 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|
Analyze 5,5-diphenyl-1-propan-2-yl-3-trimethylsilylimidazolidine-2,4-dione with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5,5-diphenyl-1-propan-2-yl-3-trimethylsilylimidazolidine-2,4-dione?
The IUPAC name of 5,5-diphenyl-1-propan-2-yl-3-trimethylsilylimidazolidine-2,4-dione (CID 140848569) is 5,5-diphenyl-1-propan-2-yl-3-trimethylsilylimidazolidine-2,4-dione.
What is the SMILES notation for 5,5-diphenyl-1-propan-2-yl-3-trimethylsilylimidazolidine-2,4-dione?
The canonical SMILES for 5,5-diphenyl-1-propan-2-yl-3-trimethylsilylimidazolidine-2,4-dione is CC(C)N1C(=O)N([Si](C)(C)C)C(=O)C1(c1ccccc1)c1ccccc1.
What is the InChIKey of 5,5-diphenyl-1-propan-2-yl-3-trimethylsilylimidazolidine-2,4-dione?
The InChIKey is VMLZOLVQGMFIGW-UHFFFAOYSA-N. The full InChI is InChI=1S/C21H26N2O2Si/c1-16(2)22-20(25)23(26(3,4)5)19(24)21(22,17-12-8-6-9-13-17)18-14-10-7-11-15-18/h6-16H,1-5H3.
What are the key properties of 5,5-diphenyl-1-propan-2-yl-3-trimethylsilylimidazolidine-2,4-dione?
5,5-diphenyl-1-propan-2-yl-3-trimethylsilylimidazolidine-2,4-dione has a molecular weight of 366.54 g/mol, XLogP of 4.44, 4 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 5,5-diphenyl-1-propan-2-yl-3-trimethylsilylimidazolidine-2,4-dione is sourced from PubChem (CID 140848569), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).