C24H14BiF2NO2 — CID 140848847
1,1-difluoro-22-phenyl-8,14-dioxa-22-aza-1λ5-bismahexacyclo[11.7.1.13,19.02,7.09,21.015,20]docosa-2,4,6,9(21),10,12,15,17,19-nonaene (PubChem CID 140848847) has the molecular formula C24H14BiF2NO2 and a molecular weight of 595.36 g/mol. Its IUPAC name is 1,1-difluoro-22-phenyl-8,14-dioxa-22-aza-1λ5-bismahexacyclo[11.7.1.13,19.02,7.09,21.015,20]docosa-2,4,6,9(21),10,12,15,17,19-nonaene.
| Compound Name | 1,1-difluoro-22-phenyl-8,14-dioxa-22-aza-1λ5-bismahexacyclo[11.7.1.13,19.02,7.09,21.015,20]docosa-2,4,6,9(21),10,12,15,17,19-nonaene |
|---|---|
| PubChem CID | 140848847 |
| Molecular Formula | C24H14BiF2NO2 |
| Molecular Weight | 595.36 g/mol |
| Exact Mass | 595.08 |
| IUPAC Name | 1,1-difluoro-22-phenyl-8,14-dioxa-22-aza-1λ5-bismahexacyclo[11.7.1.13,19.02,7.09,21.015,20]docosa-2,4,6,9(21),10,12,15,17,19-nonaene |
| SMILES | F[Bi]12(F)c3c4cccc3Oc3cccc(c31)N(c1ccccc1)c1cccc(c12)O4 |
| InChI | InChI=1S/C24H14NO2.Bi.2FH/c1-2-7-18(8-3-1)25-19-9-4-11-21(15-19)26-23-13-6-14-24(17-23)27-22-12-5-10-20(25)16-22;;;/h1-14H;;2*1H/q;+2;;/p-2 |
| InChIKey | VDNRSJHFIFROSS-UHFFFAOYSA-L |
| XLogP | 5.04 |
| TPSA | 21.70 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 30 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 595.36 |
| LogP ≤ 5 | 5.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |