C57H50N2OSi — CID 140848856
14,22-bis(4-tert-butylphenyl)-1-methyl-5,11,17-triphenyl-8-oxa-14,22-diaza-1-silahexacyclo[11.7.1.13,19.02,7.09,21.015,20]docosa-2,4,6,9,11,13(21),15(20),16,18-nonaene (PubChem CID 140848856) has the molecular formula C57H50N2OSi and a molecular weight of 807.13 g/mol. Its IUPAC name is 14,22-bis(4-tert-butylphenyl)-1-methyl-5,11,17-triphenyl-8-oxa-14,22-diaza-1-silahexacyclo[11.7.1.13,19.02,7.09,21.015,20]docosa-2,4,6,9,11,13(21),15(20),16,18-nonaene.
| Compound Name | 14,22-bis(4-tert-butylphenyl)-1-methyl-5,11,17-triphenyl-8-oxa-14,22-diaza-1-silahexacyclo[11.7.1.13,19.02,7.09,21.015,20]docosa-2,4,6,9,11,13(21),15(20),16,18-nonaene |
|---|---|
| PubChem CID | 140848856 |
| Molecular Formula | C57H50N2OSi |
| Molecular Weight | 807.13 g/mol |
| Exact Mass | 806.37 |
| IUPAC Name | 14,22-bis(4-tert-butylphenyl)-1-methyl-5,11,17-triphenyl-8-oxa-14,22-diaza-1-silahexacyclo[11.7.1.13,19.02,7.09,21.015,20]docosa-2,4,6,9,11,13(21),15(20),16,18-nonaene |
| SMILES | CC(C)(C)c1ccc(N2c3cc(-c4ccccc4)cc4c3[Si]3(C)c5c(cc(-c6ccccc6)cc5N(c5ccc(C(C)(C)C)cc5)c5cc(-c6ccccc6)cc2c53)O4)cc1 |
| InChI | InChI=1S/C57H50N2OSi/c1-56(2,3)43-23-27-45(28-24-43)58-47-31-40(37-17-11-8-12-18-37)32-48-53(47)61(7)54-49(58)33-41(38-19-13-9-14-20-38)35-51(54)60-52-36-42(39-21-15-10-16-22-39)34-50(55(52)61)59(48)46-29-25-44(26-30-46)57(4,5)6/h8-36H,1-7H3 |
| InChIKey | SUZOYSNUTTZRRW-UHFFFAOYSA-N |
| XLogP | 14.05 |
| TPSA | 15.71 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 61 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 807.13 |
| LogP ≤ 5 | 14.05 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|