C51H98O5Si — CID 140849696
[(1S,3R,4R)-4-[tert-butyl(dimethyl)silyl]oxy-3-octyl-2-[(Z)-7-oxo-7-propan-2-yloxyhept-2-enyl]cyclopentyl] 4,5,6,7,8-pentaethyl-9-methylundecanoate (PubChem CID 140849696) has the molecular formula C51H98O5Si and a molecular weight of 819.43 g/mol. Its IUPAC name is [(1S,3R,4R)-4-[tert-butyl(dimethyl)silyl]oxy-3-octyl-2-[(Z)-7-oxo-7-propan-2-yloxyhept-2-enyl]cyclopentyl] 4,5,6,7,8-pentaethyl-9-methylundecanoate.
| Compound Name | [(1S,3R,4R)-4-[tert-butyl(dimethyl)silyl]oxy-3-octyl-2-[(Z)-7-oxo-7-propan-2-yloxyhept-2-enyl]cyclopentyl] 4,5,6,7,8-pentaethyl-9-methylundecanoate |
|---|---|
| PubChem CID | 140849696 |
| Molecular Formula | C51H98O5Si |
| Molecular Weight | 819.43 g/mol |
| Exact Mass | 818.72 |
| IUPAC Name | [(1S,3R,4R)-4-[tert-butyl(dimethyl)silyl]oxy-3-octyl-2-[(Z)-7-oxo-7-propan-2-yloxyhept-2-enyl]cyclopentyl] 4,5,6,7,8-pentaethyl-9-methylundecanoate |
| SMILES | CCCCCCCC[C@@H]1C(C/C=C\CCCC(=O)OC(C)C)[C@@H](OC(=O)CCC(CC)C(CC)C(CC)C(CC)C(CC)C(C)CC)C[C@H]1O[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C51H98O5Si/c1-16-23-24-25-26-29-33-46-45(32-30-27-28-31-34-49(52)54-38(8)9)47(37-48(46)56-57(14,15)51(11,12)13)55-50(53)36-35-40(18-3)42(20-5)44(22-7)43(21-6)41(19-4)39(10)17-2/h27,30,38-48H,16-26,28-29,31-37H2,1-15H3/b30-27-/t39?,40?,41?,42?,43?,44?,45?,46-,47+,48-/m1/s1 |
| InChIKey | LVKABRHHOHWKQJ-XARJUJHBSA-N |
| XLogP | 15.70 |
| TPSA | 61.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 31 |
| Heavy Atoms | 57 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 819.43 |
| LogP ≤ 5 | 15.70 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|