About 7-hydroxy-9-trimethylsilylnona-5,8-diynenitrile
7-hydroxy-9-trimethylsilylnona-5,8-diynenitrile (PubChem CID 140849780) has the molecular formula C12H17NOSi
and a molecular weight of 219.36 g/mol. Its IUPAC name is 7-hydroxy-9-trimethylsilylnona-5,8-diynenitrile.
Molecular Properties
| Compound Name | 7-hydroxy-9-trimethylsilylnona-5,8-diynenitrile |
| PubChem CID | 140849780 |
| Molecular Formula | C12H17NOSi |
| Molecular Weight | 219.36 g/mol |
| Exact Mass | 219.11 |
| IUPAC Name | 7-hydroxy-9-trimethylsilylnona-5,8-diynenitrile |
| SMILES | C[Si](C)(C)C#CC(O)C#CCCCC#N |
| InChI | InChI=1S/C12H17NOSi/c1-15(2,3)11-9-12(14)8-6-4-5-7-10-13/h12,14H,4-5,7H2,1-3H3 |
| InChIKey | BAQAZDXUYRVPKX-UHFFFAOYSA-N |
| XLogP | 1.93 |
| TPSA | 44.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 219.36 |
| LogP ≤ 5 | 1.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|
Analyze 7-hydroxy-9-trimethylsilylnona-5,8-diynenitrile with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 7-hydroxy-9-trimethylsilylnona-5,8-diynenitrile?
The IUPAC name of 7-hydroxy-9-trimethylsilylnona-5,8-diynenitrile (CID 140849780) is 7-hydroxy-9-trimethylsilylnona-5,8-diynenitrile.
What is the SMILES notation for 7-hydroxy-9-trimethylsilylnona-5,8-diynenitrile?
The canonical SMILES for 7-hydroxy-9-trimethylsilylnona-5,8-diynenitrile is C[Si](C)(C)C#CC(O)C#CCCCC#N.
What is the InChIKey of 7-hydroxy-9-trimethylsilylnona-5,8-diynenitrile?
The InChIKey is BAQAZDXUYRVPKX-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H17NOSi/c1-15(2,3)11-9-12(14)8-6-4-5-7-10-13/h12,14H,4-5,7H2,1-3H3.
What are the key properties of 7-hydroxy-9-trimethylsilylnona-5,8-diynenitrile?
7-hydroxy-9-trimethylsilylnona-5,8-diynenitrile has a molecular weight of 219.36 g/mol, XLogP of 1.93, 2 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 7-hydroxy-9-trimethylsilylnona-5,8-diynenitrile is sourced from PubChem (CID 140849780), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).