About N-ethyl-2,5-diphenylphospholan-1-amine
N-ethyl-2,5-diphenylphospholan-1-amine (PubChem CID 140850108) has the molecular formula C18H22NP
and a molecular weight of 283.36 g/mol. Its IUPAC name is N-ethyl-2,5-diphenylphospholan-1-amine.
Molecular Properties
| Compound Name | N-ethyl-2,5-diphenylphospholan-1-amine |
| PubChem CID | 140850108 |
| Molecular Formula | C18H22NP |
| Molecular Weight | 283.36 g/mol |
| Exact Mass | 283.15 |
| IUPAC Name | N-ethyl-2,5-diphenylphospholan-1-amine |
| SMILES | CCNP1C(c2ccccc2)CCC1c1ccccc1 |
| InChI | InChI=1S/C18H22NP/c1-2-19-20-17(15-9-5-3-6-10-15)13-14-18(20)16-11-7-4-8-12-16/h3-12,17-19H,2,13-14H2,1H3 |
| InChIKey | ULURXQOLLZMVAO-UHFFFAOYSA-N |
| XLogP | 5.27 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 283.36 |
| LogP ≤ 5 | 5.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|
Analyze N-ethyl-2,5-diphenylphospholan-1-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-ethyl-2,5-diphenylphospholan-1-amine?
The IUPAC name of N-ethyl-2,5-diphenylphospholan-1-amine (CID 140850108) is N-ethyl-2,5-diphenylphospholan-1-amine.
What is the SMILES notation for N-ethyl-2,5-diphenylphospholan-1-amine?
The canonical SMILES for N-ethyl-2,5-diphenylphospholan-1-amine is CCNP1C(c2ccccc2)CCC1c1ccccc1.
What is the InChIKey of N-ethyl-2,5-diphenylphospholan-1-amine?
The InChIKey is ULURXQOLLZMVAO-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H22NP/c1-2-19-20-17(15-9-5-3-6-10-15)13-14-18(20)16-11-7-4-8-12-16/h3-12,17-19H,2,13-14H2,1H3.
What are the key properties of N-ethyl-2,5-diphenylphospholan-1-amine?
N-ethyl-2,5-diphenylphospholan-1-amine has a molecular weight of 283.36 g/mol, XLogP of 5.27, 4 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for N-ethyl-2,5-diphenylphospholan-1-amine is sourced from PubChem (CID 140850108), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).