C18H22NP — CID 140850108
N-ethyl-2,5-diphenylphospholan-1-amine (PubChem CID 140850108) has the molecular formula C18H22NP and a molecular weight of 283.36 g/mol. Its IUPAC name is N-ethyl-2,5-diphenylphospholan-1-amine.
| Compound Name | N-ethyl-2,5-diphenylphospholan-1-amine |
|---|---|
| PubChem CID | 140850108 |
| Molecular Formula | C18H22NP |
| Molecular Weight | 283.36 g/mol |
| Exact Mass | 283.15 |
| IUPAC Name | N-ethyl-2,5-diphenylphospholan-1-amine |
| SMILES | CCNP1C(c2ccccc2)CCC1c1ccccc1 |
| InChI | InChI=1S/C18H22NP/c1-2-19-20-17(15-9-5-3-6-10-15)13-14-18(20)16-11-7-4-8-12-16/h3-12,17-19H,2,13-14H2,1H3 |
| InChIKey | ULURXQOLLZMVAO-UHFFFAOYSA-N |
| XLogP | 5.27 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 283.36 |
| LogP ≤ 5 | 5.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|