About trimethyl([1,2,4]triazolo[1,5-a]pyridin-5-yl)stannane
trimethyl([1,2,4]triazolo[1,5-a]pyridin-5-yl)stannane (PubChem CID 140850311) has the molecular formula C9H13N3Sn
and a molecular weight of 281.94 g/mol. Its IUPAC name is trimethyl([1,2,4]triazolo[1,5-a]pyridin-5-yl)stannane.
Molecular Properties
| Compound Name | trimethyl([1,2,4]triazolo[1,5-a]pyridin-5-yl)stannane |
| PubChem CID | 140850311 |
| Molecular Formula | C9H13N3Sn |
| Molecular Weight | 281.94 g/mol |
| Exact Mass | 283.01 |
| IUPAC Name | trimethyl([1,2,4]triazolo[1,5-a]pyridin-5-yl)stannane |
| SMILES | C[Sn](C)(C)c1cccc2ncnn12 |
| InChI | InChI=1S/C6H4N3.3CH3.Sn/c1-2-4-9-6(3-1)7-5-8-9;;;;/h1-3,5H;3*1H3; |
| InChIKey | BWHGPPJEUUFZGR-UHFFFAOYSA-N |
| XLogP | 1.27 |
| TPSA | 30.19 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 281.94 |
| LogP ≤ 5 | 1.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze trimethyl([1,2,4]triazolo[1,5-a]pyridin-5-yl)stannane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of trimethyl([1,2,4]triazolo[1,5-a]pyridin-5-yl)stannane?
The IUPAC name of trimethyl([1,2,4]triazolo[1,5-a]pyridin-5-yl)stannane (CID 140850311) is trimethyl([1,2,4]triazolo[1,5-a]pyridin-5-yl)stannane.
What is the SMILES notation for trimethyl([1,2,4]triazolo[1,5-a]pyridin-5-yl)stannane?
The canonical SMILES for trimethyl([1,2,4]triazolo[1,5-a]pyridin-5-yl)stannane is C[Sn](C)(C)c1cccc2ncnn12.
What is the InChIKey of trimethyl([1,2,4]triazolo[1,5-a]pyridin-5-yl)stannane?
The InChIKey is BWHGPPJEUUFZGR-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H4N3.3CH3.Sn/c1-2-4-9-6(3-1)7-5-8-9;;;;/h1-3,5H;3*1H3;.
What are the key properties of trimethyl([1,2,4]triazolo[1,5-a]pyridin-5-yl)stannane?
trimethyl([1,2,4]triazolo[1,5-a]pyridin-5-yl)stannane has a molecular weight of 281.94 g/mol, XLogP of 1.27, 1 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for trimethyl([1,2,4]triazolo[1,5-a]pyridin-5-yl)stannane is sourced from PubChem (CID 140850311), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).