C11H22OSi — CID 140850595
4-(1-methyl-2,3,6,7-tetrahydrosilepin-1-yl)butan-1-ol (PubChem CID 140850595) has the molecular formula C11H22OSi and a molecular weight of 198.38 g/mol. Its IUPAC name is 4-(1-methyl-2,3,6,7-tetrahydrosilepin-1-yl)butan-1-ol.
| Compound Name | 4-(1-methyl-2,3,6,7-tetrahydrosilepin-1-yl)butan-1-ol |
|---|---|
| PubChem CID | 140850595 |
| Molecular Formula | C11H22OSi |
| Molecular Weight | 198.38 g/mol |
| Exact Mass | 198.14 |
| IUPAC Name | 4-(1-methyl-2,3,6,7-tetrahydrosilepin-1-yl)butan-1-ol |
| SMILES | C[Si]1(CCCCO)CCC=CCC1 |
| InChI | InChI=1S/C11H22OSi/c1-13(11-7-4-8-12)9-5-2-3-6-10-13/h2-3,12H,4-11H2,1H3 |
| InChIKey | DLOYXAZLFXKKDK-UHFFFAOYSA-N |
| XLogP | 3.19 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 198.38 |
| LogP ≤ 5 | 3.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|