C12H24OSi — CID 140850603
3-(1,3,6-trimethyl-2,3,6,7-tetrahydrosilepin-1-yl)propan-1-ol (PubChem CID 140850603) has the molecular formula C12H24OSi and a molecular weight of 212.41 g/mol. Its IUPAC name is 3-(1,3,6-trimethyl-2,3,6,7-tetrahydrosilepin-1-yl)propan-1-ol.
| Compound Name | 3-(1,3,6-trimethyl-2,3,6,7-tetrahydrosilepin-1-yl)propan-1-ol |
|---|---|
| PubChem CID | 140850603 |
| Molecular Formula | C12H24OSi |
| Molecular Weight | 212.41 g/mol |
| Exact Mass | 212.16 |
| IUPAC Name | 3-(1,3,6-trimethyl-2,3,6,7-tetrahydrosilepin-1-yl)propan-1-ol |
| SMILES | CC1C=CC(C)C[Si](C)(CCCO)C1 |
| InChI | InChI=1S/C12H24OSi/c1-11-5-6-12(2)10-14(3,9-11)8-4-7-13/h5-6,11-13H,4,7-10H2,1-3H3 |
| InChIKey | HMXBTBRWEFEIGX-UHFFFAOYSA-N |
| XLogP | 3.29 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 212.41 |
| LogP ≤ 5 | 3.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|