About 3-[2-(4-bromophenyl)ethenyl]-5-(2-fluoro-6-methoxyphenyl)-1H-pyrazolo[3,4-c]pyridine
3-[2-(4-bromophenyl)ethenyl]-5-(2-fluoro-6-methoxyphenyl)-1H-pyrazolo[3,4-c]pyridine (PubChem CID 140850946) has the molecular formula C21H15BrFN3O
and a molecular weight of 424.27 g/mol. Its IUPAC name is 3-[2-(4-bromophenyl)ethenyl]-5-(2-fluoro-6-methoxyphenyl)-1H-pyrazolo[3,4-c]pyridine.
Molecular Properties
| Compound Name | 3-[2-(4-bromophenyl)ethenyl]-5-(2-fluoro-6-methoxyphenyl)-1H-pyrazolo[3,4-c]pyridine |
| PubChem CID | 140850946 |
| Molecular Formula | C21H15BrFN3O |
| Molecular Weight | 424.27 g/mol |
| Exact Mass | 423.04 |
| IUPAC Name | 3-[2-(4-bromophenyl)ethenyl]-5-(2-fluoro-6-methoxyphenyl)-1H-pyrazolo[3,4-c]pyridine |
| SMILES | COc1cccc(F)c1-c1cc2c(C=Cc3ccc(Br)cc3)n[nH]c2cn1 |
| InChI | InChI=1S/C21H15BrFN3O/c1-27-20-4-2-3-16(23)21(20)18-11-15-17(25-26-19(15)12-24-18)10-7-13-5-8-14(22)9-6-13/h2-12H,1H3,(H,25,26) |
| InChIKey | JEAMIINKEAVQOS-UHFFFAOYSA-N |
| XLogP | 5.71 |
| TPSA | 50.80 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 424.27 |
| LogP ≤ 5 | 5.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 3-[2-(4-bromophenyl)ethenyl]-5-(2-fluoro-6-methoxyphenyl)-1H-pyrazolo[3,4-c]pyridine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-[2-(4-bromophenyl)ethenyl]-5-(2-fluoro-6-methoxyphenyl)-1H-pyrazolo[3,4-c]pyridine?
The IUPAC name of 3-[2-(4-bromophenyl)ethenyl]-5-(2-fluoro-6-methoxyphenyl)-1H-pyrazolo[3,4-c]pyridine (CID 140850946) is 3-[2-(4-bromophenyl)ethenyl]-5-(2-fluoro-6-methoxyphenyl)-1H-pyrazolo[3,4-c]pyridine.
What is the SMILES notation for 3-[2-(4-bromophenyl)ethenyl]-5-(2-fluoro-6-methoxyphenyl)-1H-pyrazolo[3,4-c]pyridine?
The canonical SMILES for 3-[2-(4-bromophenyl)ethenyl]-5-(2-fluoro-6-methoxyphenyl)-1H-pyrazolo[3,4-c]pyridine is COc1cccc(F)c1-c1cc2c(C=Cc3ccc(Br)cc3)n[nH]c2cn1.
What is the InChIKey of 3-[2-(4-bromophenyl)ethenyl]-5-(2-fluoro-6-methoxyphenyl)-1H-pyrazolo[3,4-c]pyridine?
The InChIKey is JEAMIINKEAVQOS-UHFFFAOYSA-N. The full InChI is InChI=1S/C21H15BrFN3O/c1-27-20-4-2-3-16(23)21(20)18-11-15-17(25-26-19(15)12-24-18)10-7-13-5-8-14(22)9-6-13/h2-12H,1H3,(H,25,26).
What are the key properties of 3-[2-(4-bromophenyl)ethenyl]-5-(2-fluoro-6-methoxyphenyl)-1H-pyrazolo[3,4-c]pyridine?
3-[2-(4-bromophenyl)ethenyl]-5-(2-fluoro-6-methoxyphenyl)-1H-pyrazolo[3,4-c]pyridine has a molecular weight of 424.27 g/mol, XLogP of 5.71, 4 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 3-[2-(4-bromophenyl)ethenyl]-5-(2-fluoro-6-methoxyphenyl)-1H-pyrazolo[3,4-c]pyridine is sourced from PubChem (CID 140850946), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).