C34H39FN4O7 — CID 140851166
tert-butyl 2-[4-[(4-fluorophenyl)methyl-[2-[6-(methylcarbamoylamino)-2',4'-dioxospiro[1,2-dihydroindene-3,5'-1,3-oxazolidine]-3'-yl]acetyl]amino]cyclohexylidene]acetate (PubChem CID 140851166) has the molecular formula C34H39FN4O7 and a molecular weight of 634.71 g/mol. Its IUPAC name is tert-butyl 2-[4-[(4-fluorophenyl)methyl-[2-[6-(methylcarbamoylamino)-2',4'-dioxospiro[1,2-dihydroindene-3,5'-1,3-oxazolidine]-3'-yl]acetyl]amino]cyclohexylidene]acetate.
| Compound Name | tert-butyl 2-[4-[(4-fluorophenyl)methyl-[2-[6-(methylcarbamoylamino)-2',4'-dioxospiro[1,2-dihydroindene-3,5'-1,3-oxazolidine]-3'-yl]acetyl]amino]cyclohexylidene]acetate |
|---|---|
| PubChem CID | 140851166 |
| Molecular Formula | C34H39FN4O7 |
| Molecular Weight | 634.71 g/mol |
| Exact Mass | 634.28 |
| IUPAC Name | tert-butyl 2-[4-[(4-fluorophenyl)methyl-[2-[6-(methylcarbamoylamino)-2',4'-dioxospiro[1,2-dihydroindene-3,5'-1,3-oxazolidine]-3'-yl]acetyl]amino]cyclohexylidene]acetate |
| SMILES | CNC(=O)Nc1ccc2c(c1)CCC21OC(=O)N(CC(=O)N(Cc2ccc(F)cc2)C2CCC(=CC(=O)OC(C)(C)C)CC2)C1=O |
| InChI | InChI=1S/C34H39FN4O7/c1-33(2,3)45-29(41)17-21-7-12-26(13-8-21)38(19-22-5-9-24(35)10-6-22)28(40)20-39-30(42)34(46-32(39)44)16-15-23-18-25(11-14-27(23)34)37-31(43)36-4/h5-6,9-11,14,17-18,26H,7-8,12-13,15-16,19-20H2,1-4H3,(H2,36,37,43)/b21-17- |
| InChIKey | ZWAUXGSTDYNFKZ-FXBPSFAMSA-N |
| XLogP | 4.94 |
| TPSA | 134.35 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 46 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 634.71 |
| LogP ≤ 5 | 4.94 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|