About 2-chlorobutane
2-chlorobutane (PubChem CID 140851929) has the molecular formula C4H8Cl+
and a molecular weight of 91.56 g/mol. Its IUPAC name is 2-chlorobutane.
Molecular Properties
| Compound Name | 2-chlorobutane |
| PubChem CID | 140851929 |
| Molecular Formula | C4H8Cl+ |
| Molecular Weight | 91.56 g/mol |
| Exact Mass | 91.03 |
| IUPAC Name | 2-chlorobutane |
| SMILES | [CH2+]CC(C)Cl |
| InChI | InChI=1S/C4H8Cl/c1-3-4(2)5/h4H,1,3H2,2H3/q+1 |
| InChIKey | HWQXLYXLNOFLTF-UHFFFAOYSA-N |
| XLogP | 1.84 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 1 |
| Heavy Atoms | 5 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 91.56 |
| LogP ≤ 5 | 1.84 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|
Analyze 2-chlorobutane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-chlorobutane?
The IUPAC name of 2-chlorobutane (CID 140851929) is 2-chlorobutane.
What is the SMILES notation for 2-chlorobutane?
The canonical SMILES for 2-chlorobutane is [CH2+]CC(C)Cl.
What is the InChIKey of 2-chlorobutane?
The InChIKey is HWQXLYXLNOFLTF-UHFFFAOYSA-N. The full InChI is InChI=1S/C4H8Cl/c1-3-4(2)5/h4H,1,3H2,2H3/q+1.
What are the key properties of 2-chlorobutane?
2-chlorobutane has a molecular weight of 91.56 g/mol, XLogP of 1.84, 1 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for 2-chlorobutane is sourced from PubChem (CID 140851929), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).