C24H22F3N5O4 — CID 140852854
[3-methyl-5-[[5-methyl-2-(3,4,5-trimethylanilino)pyrimidin-4-yl]amino]-2-oxo-1,3-benzoxazol-4-yl] 2,2,2-trifluoroacetate (PubChem CID 140852854) has the molecular formula C24H22F3N5O4 and a molecular weight of 501.47 g/mol. Its IUPAC name is [3-methyl-5-[[5-methyl-2-(3,4,5-trimethylanilino)pyrimidin-4-yl]amino]-2-oxo-1,3-benzoxazol-4-yl] 2,2,2-trifluoroacetate.
| Compound Name | [3-methyl-5-[[5-methyl-2-(3,4,5-trimethylanilino)pyrimidin-4-yl]amino]-2-oxo-1,3-benzoxazol-4-yl] 2,2,2-trifluoroacetate |
|---|---|
| PubChem CID | 140852854 |
| Molecular Formula | C24H22F3N5O4 |
| Molecular Weight | 501.47 g/mol |
| Exact Mass | 501.16 |
| IUPAC Name | [3-methyl-5-[[5-methyl-2-(3,4,5-trimethylanilino)pyrimidin-4-yl]amino]-2-oxo-1,3-benzoxazol-4-yl] 2,2,2-trifluoroacetate |
| SMILES | Cc1cnc(Nc2cc(C)c(C)c(C)c2)nc1Nc1ccc2oc(=O)n(C)c2c1OC(=O)C(F)(F)F |
| InChI | InChI=1S/C24H22F3N5O4/c1-11-8-15(9-12(2)14(11)4)29-22-28-10-13(3)20(31-22)30-16-6-7-17-18(32(5)23(34)35-17)19(16)36-21(33)24(25,26)27/h6-10H,1-5H3,(H2,28,29,30,31) |
| InChIKey | QPWGWTRZQYGPJU-UHFFFAOYSA-N |
| XLogP | 5.11 |
| TPSA | 111.28 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 501.47 |
| LogP ≤ 5 | 5.11 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|