About 10-([1]benzoselenolo[2,3-b]pyrazin-7-yl)phenothiazine
10-([1]benzoselenolo[2,3-b]pyrazin-7-yl)phenothiazine (PubChem CID 140852994) has the molecular formula C22H13N3SSe
and a molecular weight of 430.39 g/mol. Its IUPAC name is 10-([1]benzoselenolo[2,3-b]pyrazin-7-yl)phenothiazine.
Molecular Properties
| Compound Name | 10-([1]benzoselenolo[2,3-b]pyrazin-7-yl)phenothiazine |
| PubChem CID | 140852994 |
| Molecular Formula | C22H13N3SSe |
| Molecular Weight | 430.39 g/mol |
| Exact Mass | 431.00 |
| IUPAC Name | 10-([1]benzoselenolo[2,3-b]pyrazin-7-yl)phenothiazine |
| SMILES | c1ccc2c(c1)Sc1ccccc1N2c1ccc2c(c1)[se]c1nccnc12 |
| InChI | InChI=1S/C22H13N3SSe/c1-3-7-18-16(5-1)25(17-6-2-4-8-19(17)26-18)14-9-10-15-20(13-14)27-22-21(15)23-11-12-24-22/h1-13H |
| InChIKey | VVOHVATUNIHGFL-UHFFFAOYSA-N |
| XLogP | 5.77 |
| TPSA | 29.02 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 27 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 430.39 |
| LogP ≤ 5 | 5.77 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze 10-([1]benzoselenolo[2,3-b]pyrazin-7-yl)phenothiazine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 10-([1]benzoselenolo[2,3-b]pyrazin-7-yl)phenothiazine?
The IUPAC name of 10-([1]benzoselenolo[2,3-b]pyrazin-7-yl)phenothiazine (CID 140852994) is 10-([1]benzoselenolo[2,3-b]pyrazin-7-yl)phenothiazine.
What is the SMILES notation for 10-([1]benzoselenolo[2,3-b]pyrazin-7-yl)phenothiazine?
The canonical SMILES for 10-([1]benzoselenolo[2,3-b]pyrazin-7-yl)phenothiazine is c1ccc2c(c1)Sc1ccccc1N2c1ccc2c(c1)[se]c1nccnc12.
What is the InChIKey of 10-([1]benzoselenolo[2,3-b]pyrazin-7-yl)phenothiazine?
The InChIKey is VVOHVATUNIHGFL-UHFFFAOYSA-N. The full InChI is InChI=1S/C22H13N3SSe/c1-3-7-18-16(5-1)25(17-6-2-4-8-19(17)26-18)14-9-10-15-20(13-14)27-22-21(15)23-11-12-24-22/h1-13H.
What are the key properties of 10-([1]benzoselenolo[2,3-b]pyrazin-7-yl)phenothiazine?
10-([1]benzoselenolo[2,3-b]pyrazin-7-yl)phenothiazine has a molecular weight of 430.39 g/mol, XLogP of 5.77, 1 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 10-([1]benzoselenolo[2,3-b]pyrazin-7-yl)phenothiazine is sourced from PubChem (CID 140852994), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).