C34H37N7O3Si — CID 140853460
7-methoxy-6-(4-methoxyphenyl)-2,3-diphenyl-N-[1-(2-trimethylsilylethoxymethyl)-1,2,4-triazol-3-yl]pyrazolo[1,5-a]pyrimidin-5-amine (PubChem CID 140853460) has the molecular formula C34H37N7O3Si and a molecular weight of 619.80 g/mol. Its IUPAC name is 7-methoxy-6-(4-methoxyphenyl)-2,3-diphenyl-N-[1-(2-trimethylsilylethoxymethyl)-1,2,4-triazol-3-yl]pyrazolo[1,5-a]pyrimidin-5-amine.
| Compound Name | 7-methoxy-6-(4-methoxyphenyl)-2,3-diphenyl-N-[1-(2-trimethylsilylethoxymethyl)-1,2,4-triazol-3-yl]pyrazolo[1,5-a]pyrimidin-5-amine |
|---|---|
| PubChem CID | 140853460 |
| Molecular Formula | C34H37N7O3Si |
| Molecular Weight | 619.80 g/mol |
| Exact Mass | 619.27 |
| IUPAC Name | 7-methoxy-6-(4-methoxyphenyl)-2,3-diphenyl-N-[1-(2-trimethylsilylethoxymethyl)-1,2,4-triazol-3-yl]pyrazolo[1,5-a]pyrimidin-5-amine |
| SMILES | COc1ccc(-c2c(Nc3ncn(COCC[Si](C)(C)C)n3)nc3c(-c4ccccc4)c(-c4ccccc4)nn3c2OC)cc1 |
| InChI | InChI=1S/C34H37N7O3Si/c1-42-27-18-16-25(17-19-27)29-31(37-34-35-22-40(39-34)23-44-20-21-45(3,4)5)36-32-28(24-12-8-6-9-13-24)30(26-14-10-7-11-15-26)38-41(32)33(29)43-2/h6-19,22H,20-21,23H2,1-5H3,(H,36,37,39) |
| InChIKey | JQYUMCGQBHFKCM-UHFFFAOYSA-N |
| XLogP | 7.39 |
| TPSA | 100.62 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 619.80 |
| LogP ≤ 5 | 7.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|