C35H38N6O3Si — CID 140853503
7-methoxy-6-(4-methoxyphenyl)-2,3-diphenyl-N-[1-(2-trimethylsilylethoxymethyl)pyrazol-3-yl]pyrazolo[1,5-a]pyrimidin-5-amine (PubChem CID 140853503) has the molecular formula C35H38N6O3Si and a molecular weight of 618.81 g/mol. Its IUPAC name is 7-methoxy-6-(4-methoxyphenyl)-2,3-diphenyl-N-[1-(2-trimethylsilylethoxymethyl)pyrazol-3-yl]pyrazolo[1,5-a]pyrimidin-5-amine.
| Compound Name | 7-methoxy-6-(4-methoxyphenyl)-2,3-diphenyl-N-[1-(2-trimethylsilylethoxymethyl)pyrazol-3-yl]pyrazolo[1,5-a]pyrimidin-5-amine |
|---|---|
| PubChem CID | 140853503 |
| Molecular Formula | C35H38N6O3Si |
| Molecular Weight | 618.81 g/mol |
| Exact Mass | 618.28 |
| IUPAC Name | 7-methoxy-6-(4-methoxyphenyl)-2,3-diphenyl-N-[1-(2-trimethylsilylethoxymethyl)pyrazol-3-yl]pyrazolo[1,5-a]pyrimidin-5-amine |
| SMILES | COc1ccc(-c2c(Nc3ccn(COCC[Si](C)(C)C)n3)nc3c(-c4ccccc4)c(-c4ccccc4)nn3c2OC)cc1 |
| InChI | InChI=1S/C35H38N6O3Si/c1-42-28-18-16-26(17-19-28)31-33(36-29-20-21-40(38-29)24-44-22-23-45(3,4)5)37-34-30(25-12-8-6-9-13-25)32(27-14-10-7-11-15-27)39-41(34)35(31)43-2/h6-21H,22-24H2,1-5H3,(H,36,37,38) |
| InChIKey | BCCZUZUQRZRHHK-UHFFFAOYSA-N |
| XLogP | 8.00 |
| TPSA | 87.73 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 618.81 |
| LogP ≤ 5 | 8.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|