C13H14N4O5 — CID 14085378
ethyl 3-carbamoyl-2-(3-nitrophenyl)-3,4-dihydropyrazole-5-carboxylate (PubChem CID 14085378) has the molecular formula C13H14N4O5 and a molecular weight of 306.28 g/mol. Its IUPAC name is ethyl 3-carbamoyl-2-(3-nitrophenyl)-3,4-dihydropyrazole-5-carboxylate.
| Compound Name | ethyl 3-carbamoyl-2-(3-nitrophenyl)-3,4-dihydropyrazole-5-carboxylate |
|---|---|
| PubChem CID | 14085378 |
| Molecular Formula | C13H14N4O5 |
| Molecular Weight | 306.28 g/mol |
| Exact Mass | 306.10 |
| IUPAC Name | ethyl 3-carbamoyl-2-(3-nitrophenyl)-3,4-dihydropyrazole-5-carboxylate |
| SMILES | CCOC(=O)C1=NN(c2cccc([N+](=O)[O-])c2)C(C(N)=O)C1 |
| InChI | InChI=1S/C13H14N4O5/c1-2-22-13(19)10-7-11(12(14)18)16(15-10)8-4-3-5-9(6-8)17(20)21/h3-6,11H,2,7H2,1H3,(H2,14,18) |
| InChIKey | JGJALUPJRQJWQQ-UHFFFAOYSA-N |
| XLogP | 0.58 |
| TPSA | 128.13 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.28 |
| LogP ≤ 5 | 0.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|