C56H63N3 — CID 140854154
7-tert-butyl-9-[6-(3,6-ditert-butyl-9H-carbazol-1-yl)-4-(3,5-ditert-butylphenyl)-2-pyridinyl]benzo[h]quinoline (PubChem CID 140854154) has the molecular formula C56H63N3 and a molecular weight of 778.14 g/mol. Its IUPAC name is 7-tert-butyl-9-[6-(3,6-ditert-butyl-9H-carbazol-1-yl)-4-(3,5-ditert-butylphenyl)-2-pyridinyl]benzo[h]quinoline.
| Compound Name | 7-tert-butyl-9-[6-(3,6-ditert-butyl-9H-carbazol-1-yl)-4-(3,5-ditert-butylphenyl)-2-pyridinyl]benzo[h]quinoline |
|---|---|
| PubChem CID | 140854154 |
| Molecular Formula | C56H63N3 |
| Molecular Weight | 778.14 g/mol |
| Exact Mass | 777.50 |
| IUPAC Name | 7-tert-butyl-9-[6-(3,6-ditert-butyl-9H-carbazol-1-yl)-4-(3,5-ditert-butylphenyl)-2-pyridinyl]benzo[h]quinoline |
| SMILES | CC(C)(C)c1cc(-c2cc(-c3cc(C(C)(C)C)c4ccc5cccnc5c4c3)nc(-c3cc(C(C)(C)C)cc4c3[nH]c3ccc(C(C)(C)C)cc34)c2)cc(C(C)(C)C)c1 |
| InChI | InChI=1S/C56H63N3/c1-52(2,3)37-19-21-47-42(30-37)44-31-40(55(10,11)12)32-45(51(44)59-47)49-28-35(34-23-38(53(4,5)6)29-39(24-34)54(7,8)9)27-48(58-49)36-25-43-41(46(26-36)56(13,14)15)20-18-33-17-16-22-57-50(33)43/h16-32,59H,1-15H3 |
| InChIKey | KHUZHMBSUBVYBB-UHFFFAOYSA-N |
| XLogP | 15.91 |
| TPSA | 41.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 59 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 778.14 |
| LogP ≤ 5 | 15.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|