C22H32BFN2O5 — CID 140854287
tert-butyl (3R)-3-[[2-fluoro-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)benzoyl]amino]pyrrolidine-1-carboxylate (PubChem CID 140854287) has the molecular formula C22H32BFN2O5 and a molecular weight of 434.32 g/mol. Its IUPAC name is tert-butyl (3R)-3-[[2-fluoro-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)benzoyl]amino]pyrrolidine-1-carboxylate.
| Compound Name | tert-butyl (3R)-3-[[2-fluoro-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)benzoyl]amino]pyrrolidine-1-carboxylate |
|---|---|
| PubChem CID | 140854287 |
| Molecular Formula | C22H32BFN2O5 |
| Molecular Weight | 434.32 g/mol |
| Exact Mass | 434.24 |
| IUPAC Name | tert-butyl (3R)-3-[[2-fluoro-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)benzoyl]amino]pyrrolidine-1-carboxylate |
| SMILES | CC(C)(C)OC(=O)N1CC[C@@H](NC(=O)c2ccc(B3OC(C)(C)C(C)(C)O3)cc2F)C1 |
| InChI | InChI=1S/C22H32BFN2O5/c1-20(2,3)29-19(28)26-11-10-15(13-26)25-18(27)16-9-8-14(12-17(16)24)23-30-21(4,5)22(6,7)31-23/h8-9,12,15H,10-11,13H2,1-7H3,(H,25,27)/t15-/m1/s1 |
| InChIKey | YBMMTBFMNFICSF-OAHLLOKOSA-N |
| XLogP | 2.86 |
| TPSA | 77.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 434.32 |
| LogP ≤ 5 | 2.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|