About 4aH-phenazin-5-ide
4aH-phenazin-5-ide (PubChem CID 140854536) has the molecular formula C12H9N2-
and a molecular weight of 181.22 g/mol. Its IUPAC name is 4aH-phenazin-5-ide.
Molecular Properties
| Compound Name | 4aH-phenazin-5-ide |
| PubChem CID | 140854536 |
| Molecular Formula | C12H9N2- |
| Molecular Weight | 181.22 g/mol |
| Exact Mass | 181.08 |
| IUPAC Name | 4aH-phenazin-5-ide |
| SMILES | C1=CC2=Nc3ccccc3[N-]C2C=C1 |
| InChI | InChI=1S/C12H9N2/c1-2-6-10-9(5-1)13-11-7-3-4-8-12(11)14-10/h1-9H/q-1 |
| InChIKey | DLPKKEUIZOQOSL-UHFFFAOYSA-N |
| XLogP | 3.27 |
| TPSA | 26.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 181.22 |
| LogP ≤ 5 | 3.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 4aH-phenazin-5-ide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4aH-phenazin-5-ide?
The IUPAC name of 4aH-phenazin-5-ide (CID 140854536) is 4aH-phenazin-5-ide.
What is the SMILES notation for 4aH-phenazin-5-ide?
The canonical SMILES for 4aH-phenazin-5-ide is C1=CC2=Nc3ccccc3[N-]C2C=C1.
What is the InChIKey of 4aH-phenazin-5-ide?
The InChIKey is DLPKKEUIZOQOSL-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H9N2/c1-2-6-10-9(5-1)13-11-7-3-4-8-12(11)14-10/h1-9H/q-1.
What are the key properties of 4aH-phenazin-5-ide?
4aH-phenazin-5-ide has a molecular weight of 181.22 g/mol, XLogP of 3.27, 0 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 4aH-phenazin-5-ide is sourced from PubChem (CID 140854536), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).