C35H40FN7O2S — CID 140855720
N-[1-[[(2R)-1-(2-cyano-4-methylpent-2-enoyl)pyrrolidin-2-yl]methyl]-5-[(2,2-dimethylpropylamino)methyl]benzimidazol-2-yl]-5-(2-fluoro-4-pyridinyl)thiophene-2-carboxamide (PubChem CID 140855720) has the molecular formula C35H40FN7O2S and a molecular weight of 641.82 g/mol. Its IUPAC name is N-[1-[[(2R)-1-(2-cyano-4-methylpent-2-enoyl)pyrrolidin-2-yl]methyl]-5-[(2,2-dimethylpropylamino)methyl]benzimidazol-2-yl]-5-(2-fluoro-4-pyridinyl)thiophene-2-carboxamide.
| Compound Name | N-[1-[[(2R)-1-(2-cyano-4-methylpent-2-enoyl)pyrrolidin-2-yl]methyl]-5-[(2,2-dimethylpropylamino)methyl]benzimidazol-2-yl]-5-(2-fluoro-4-pyridinyl)thiophene-2-carboxamide |
|---|---|
| PubChem CID | 140855720 |
| Molecular Formula | C35H40FN7O2S |
| Molecular Weight | 641.82 g/mol |
| Exact Mass | 641.29 |
| IUPAC Name | N-[1-[[(2R)-1-(2-cyano-4-methylpent-2-enoyl)pyrrolidin-2-yl]methyl]-5-[(2,2-dimethylpropylamino)methyl]benzimidazol-2-yl]-5-(2-fluoro-4-pyridinyl)thiophene-2-carboxamide |
| SMILES | CC(C)C=C(C#N)C(=O)N1CCC[C@@H]1Cn1c(NC(=O)c2ccc(-c3ccnc(F)c3)s2)nc2cc(CNCC(C)(C)C)ccc21 |
| InChI | InChI=1S/C35H40FN7O2S/c1-22(2)15-25(18-37)33(45)42-14-6-7-26(42)20-43-28-9-8-23(19-38-21-35(3,4)5)16-27(28)40-34(43)41-32(44)30-11-10-29(46-30)24-12-13-39-31(36)17-24/h8-13,15-17,22,26,38H,6-7,14,19-21H2,1-5H3,(H,40,41,44)/t26-/m1/s1 |
| InChIKey | ODLNFBHHWNAOFI-AREMUKBSSA-N |
| XLogP | 6.78 |
| TPSA | 115.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 641.82 |
| LogP ≤ 5 | 6.78 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|